Item 18 of 30 (back to results) previous next salaspermic acid A hexacyclic triterpenoid that is D:A-friedooleanan-29-oic acid substituted by a hydroxy group at position 3 and an epoxy group across positions 3 and 24 (the (3beta,20alpha stereoisomer). Isolated from Salacia macrosperma and Tripterygium wilfordii, it exhibits anti-HIV activity.

Current search: 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antiviral agent [CHEBI:22587] > anti-HIV agent [CHEBI:64946] > anti-HIV-1 agent [CHEBI:64947] > HIV-1 reverse transcriptase inhibitor [CHEBI:53756] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   salaspermic acid [CHEBI:66153] (1)  antimicrobial agent [CHEBI:33281] (927)   antiviral agent [CHEBI:22587] (216)   anti-HIV agent [CHEBI:64946] (126)   anti-HIV-1 agent [CHEBI:64947] (79)   HIV-1 reverse transcriptase inhibitor [CHEBI:53756] (30)   salaspermic acid [CHEBI:66153] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Celastrales (20)   Celastraceae (20)   Tripterygium (3)   Tripterygium wilfordii (3) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  plant structure [PO:0009011] (1497)   multi-tissue plant structure [PO:0025496] (1114)   plant organ [PO:0009008] (970)   plant axis [PO:0025004] (691)   root [PO:0009005] (486) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   salaspermic acid [CHEBI:66153] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   salaspermic acid [CHEBI:66153] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   salaspermic acid [CHEBI:66153] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   salaspermic acid [CHEBI:66153] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   triterpenoid [CHEBI:36615] (228)   hexacyclic triterpenoid [CHEBI:70994] (27)   salaspermic acid [CHEBI:66153] (1)  isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   triterpenoid [CHEBI:36615] (228)   hexacyclic triterpenoid [CHEBI:70994] (27)   salaspermic acid [CHEBI:66153] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   salaspermic acid [CHEBI:66153] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   salaspermic acid [CHEBI:66153] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   salaspermic acid [CHEBI:66153] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   salaspermic acid [CHEBI:66153] (1)  organic polycyclic compound [CHEBI:51958] (1654)   hexacyclic triterpenoid [CHEBI:70994] (27)   salaspermic acid [CHEBI:66153] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   organic polycyclic compound [CHEBI:51958] (1654)   hexacyclic triterpenoid [CHEBI:70994] (27)   salaspermic acid [CHEBI:66153] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   salaspermic acid [CHEBI:66153] (1)  organic polycyclic compound [CHEBI:51958] (1654)   hexacyclic triterpenoid [CHEBI:70994] (27)   salaspermic acid [CHEBI:66153] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   salaspermic acid [CHEBI:66153] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   salaspermic acid [CHEBI:66153] (1)  organic polycyclic compound [CHEBI:51958] (1654)   hexacyclic triterpenoid [CHEBI:70994] (27)   salaspermic acid [CHEBI:66153] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   salaspermic acid [CHEBI:66153] (1) ChEBI Compound Accession Identifier:   [CHEBI:66153] ChEBI Compound Description:   A hexacyclic triterpenoid that is D:A-friedooleanan-29-oic acid substituted by a hydroxy group at position 3 and an epoxy group across positions 3 and 24 (the (3beta,20alpha stereoisomer). Isolated from Salacia macrosperma and Tripterygium wilfordii, it exhibits anti-HIV activity. ChEBI Compound Identification Number:   66153 ChEBI InChI Value:   InChI=1S/C30H48O4/c1-19-29-9-7-20-26(4,21(29)8-10-30(19,33)34-18-29)14-16-28(6)22-17-25(3,23(31)32)12-11-24(22,2)13-15-27(20,28)5/h19-22,33H,7-18H2,1-6H3,(H,31,32)/t19-,20+,21+,22-,24-,25-,26-,27-,28+,29+,30+/m1/s1 ChEBI InChIKey Value:   ZXENWDWQTWYUGY-UUZWCOCASA-N ChEBI Compound Name:   salaspermic acid ChEBI SMILES Value:   [H][C@@]12CC[C@]3(O)OC[C@@]1(CC[C@@]1([H])[C@@]2(C)CC[C@@]2(C)[C@]4([H])C[C@@](C)(CC[C@]4(C)CC[C@]12C)C(O)=O)[C@H]3C ChEBI Substance ID:   160709756 ChEBI URL:   ChEBI:66153 ChemSpider ID:   23327152 Ontomatica Chemical Accession Key (OnChAKey):   ZXENWDWQTWYUGY_UUZWCOCASA_N_000_000000 PubChem Compound ID:   44593364