New Search

Item 19 of 29 (back to results)
Previous previous next Next

melphalan
A phenylalanine derivative comprising L-phenylalanine having [bis(2-chloroethyl)amino group at the 4-position on the phenyl ring.


Current search:

03. Biological Effects of Specific Chemicals: aetiopathogenetic uses [CHEBI:52209] > genotoxin [CHEBI:50902] > mutagen [CHEBI:25435] > alkylating agent [CHEBI:22333]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 aetiopathogenetic uses [CHEBI:52209] (178) 
 genotoxin [CHEBI:50902] (78) 
 mutagen [CHEBI:25435] (74) 
 alkylating agent [CHEBI:22333] (29) 
 melphalan [CHEBI:28876] (1)
 carcinogenic agent [CHEBI:50903] (40) 
 melphalan [CHEBI:28876] (1)
 immunomodulator [CHEBI:50846] (61) 
 immunosuppressive agent [CHEBI:35705] (43) 
 melphalan [CHEBI:28876] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 melphalan [CHEBI:28876] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 chlorine molecular entity [CHEBI:23117] (884) 
 organochlorine compound [CHEBI:36683] (543) 
 melphalan [CHEBI:28876] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 melphalan [CHEBI:28876] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 nitrogen mustard [CHEBI:37598] (11) 
 melphalan [CHEBI:28876] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organonitrogen compound [CHEBI:35352] (6705) 
 nitrogen mustard [CHEBI:37598] (11) 
 melphalan [CHEBI:28876] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 melphalan [CHEBI:28876] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 melphalan [CHEBI:28876] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 melphalan [CHEBI:28876] (1)
ChEBI Compound Accession Identifier  [CHEBI:28876]
ChEBI Compound Description  A phenylalanine derivative comprising L-phenylalanine having [bis(2-chloroethyl)amino group at the 4-position on the phenyl ring.
ChEBI Compound Identification Number  28876
ChEBI InChI Value  InChI=1S/C13H18Cl2N2O2/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19/h1-4,12H,5-9,16H2,(H,18,19)/t12-/m0/s1
ChEBI InChIKey Value  SGDBTWWWUNNDEQ-LBPRGKRZSA-N
ChEBI Compound Name  melphalan
ChEBI SMILES Value  N[C@@H](Cc1ccc(cc1)N(CCCl)CCCl)C(O)=O
ChEBI Substance ID  111978138
ChEBI URL  ChEBI:28876
ChemSpider ID  405297
Ontomatica Chemical Accession Key (OnChAKey)  SGDBTWWWUNNDEQ_LBPRGKRZSA_N_000_000000
PubChem Compound ID  460612