Item 3 of 3 (back to results) previous kempopeptin B A 19-membered cyclodepsipeptide isolated from Floridian marine cyanobacterium Lyngbya sp. It exhibits inhibitory activity towards enzyme trypsin.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > enzyme inhibitor [CHEBI:23924] > protease inhibitor [CHEBI:37670] > serine protease inhibitor [CHEBI:64926] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   protease inhibitor [CHEBI:37670] (37)   serine protease inhibitor [CHEBI:64926] (3)   kempopeptin B [CHEBI:66143] (1)  metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   kempopeptin B [CHEBI:66143] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Archaea, Cyanobacteria and Bacteria (302)   Cyanobacteria (63)   Oscillatoriales (58)   Lyngbya (30) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  unspecified structure [PO:0000004] (703) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   bromine molecular entity [CHEBI:22928] (199)   organobromine compound [CHEBI:37141] (138)   kempopeptin B [CHEBI:66143] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   kempopeptin B [CHEBI:66143] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   kempopeptin B [CHEBI:66143] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  ester [CHEBI:35701] (3370)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   depsipeptide [CHEBI:23643] (64)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  macrocycle [CHEBI:51026] (234)   kempopeptin B [CHEBI:66143] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   cyclodepsipeptide [CHEBI:35213] (63)   kempopeptin B [CHEBI:66143] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   kempopeptin B [CHEBI:66143] (1) ChEBI Compound Accession Identifier:   [CHEBI:66143] ChEBI Compound Description:   A 19-membered cyclodepsipeptide isolated from Floridian marine cyanobacterium Lyngbya sp. It exhibits inhibitory activity towards enzyme trypsin. ChEBI Compound Identification Number:   66143 ChEBI InChI Value:   InChI=1S/C46H73BrN8O11/c1-11-15-34(56)51-36(24(3)4)42(60)53-38-27(8)66-46(64)37(25(5)6)52-41(59)32(23-28-17-19-33(65-10)29(47)22-28)54(9)45(63)39(26(7)12-2)55-35(57)20-18-31(44(55)62)50-40(58)30(49-43(38)61)16-13-14-21-48/h17,19,22,24-27,30-32,35-39,57H,11-16,18,20-21,23,48H2,1-10H3,(H,49,61)(H,50,58)(H,51,56)(H,52,59)(H,53,60)/t26-,27-,30+,31-,32+,35-,36+,37+,38+,39+/m1/s1 ChEBI InChIKey Value:   BESCRSMOIPNLKZ-BZKFFGQOSA-N ChEBI Compound Name:   kempopeptin B ChEBI SMILES Value:   [H][C@@]12CC[C@@H](O)N(C1=O)[C@@]([H])([C@H](C)CC)C(=O)N(C)[C@@H](Cc1ccc(OC)c(Br)c1)C(=O)N[C@@H](C(C)C)C(=O)O[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)CCC)C(C)C)C(=O)N[C@@H](CCCCN)C(=O)N2 ChEBI Substance ID:   160645307 ChEBI URL:   ChEBI:66143 ChemSpider ID:   28533019 Ontomatica Chemical Accession Key (OnChAKey):   BESCRSMOIPNLKZ_BZKFFGQOSA_N_000_000000 PubChem Compound ID:   70678772