New Search

Item 3 of 34 (back to results)
Previous previous next Next

L-ethionine
An S-ethylhomocysteine that has S-configuration at the chiral centre.


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > antimetabolite [CHEBI:35221]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 antimetabolite [CHEBI:35221] (34) 
 L-ethionine [CHEBI:4886] (1)
 aetiopathogenetic uses [CHEBI:52209] (178) 
 carcinogenic agent [CHEBI:50903] (40) 
 L-ethionine [CHEBI:4886] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 primary amino compound [CHEBI:50994] (104) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 sulfur molecular entity [CHEBI:26835] (1541) 
 sulfide [CHEBI:26822] (86) 
 organic sulfide [CHEBI:16385] (82) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 organosulfur compound [CHEBI:33261] (1005) 
 organic sulfide [CHEBI:16385] (82) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organic sulfide [CHEBI:16385] (82) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 primary amino compound [CHEBI:50994] (104) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organic sulfide [CHEBI:16385] (82) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 primary amino compound [CHEBI:50994] (104) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
 amino acid [CHEBI:33709] (959) 
 alpha-amino acid [CHEBI:10208] (233) 
 S-ethylhomocysteine [CHEBI:68662] (3) 
 L-ethionine [CHEBI:4886] (1)
ChEBI Compound Accession Identifier  [CHEBI:4886]
ChEBI Compound Description  An S-ethylhomocysteine that has S-configuration at the chiral centre.
ChEBI Compound Identification Number  4886
ChEBI InChI Value  InChI=1S/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m0/s1
ChEBI InChIKey Value  GGLZPLKKBSSKCX-YFKPBYRVSA-N
ChEBI Compound Name  L-ethionine
ChEBI SMILES Value  CCSCC[C@H](N)C(O)=O
ChEBI Substance ID  160644693
ChEBI URL  ChEBI:4886
ChemSpider ID  23916
Ontomatica Chemical Accession Key (OnChAKey)  GGLZPLKKBSSKCX_YFKPBYRVSA_N_000_000000
PubChem Compound ID  25674