| more general categories |
information about this item |
|
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
Egg (37) |
|
|
|
Cattle, fat (61) |
|
|
|
Cattle, meat (59) |
|
|
|
Cattle, meat byproducts (57) |
|
|
|
Goat, fat (57) |
|
|
|
Goat, meat (56) |
|
|
|
Goat, meat byproducts (55) |
|
|
|
Hog, fat (44) |
|
|
|
Hog, meat (42) |
|
|
|
Hog, meat byproducts (41) |
|
|
|
Horse, fat (57) |
|
|
|
Horse, meat (54) |
|
|
|
Horse, meat byproducts (55) |
|
|
|
Milk, fat (24) |
|
|
|
Poultry, fat (34) |
|
|
|
Poultry, meat (32) |
|
|
|
Poultry, meat byproducts (32) |
|
|
|
Sheep, fat (57) |
|
|
|
Sheep, meat (56) |
|
|
|
Sheep, meat byproducts (55) |
|
|
|
|
|
|
|
Peanut (30) |
|
|
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 01 Subgroup 1C : Tuberous & corm vegetables subgroup (16) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 04 : Leafy Vegetables (except Brassica Vegetables) Group (21) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 : Brassica (Cole) Leafy Vegetables Group (11) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |
|
|
|
|
|
|
|
Okra (17) |
|
|
|
|
|
|
|
Okra (17) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) |
|
|
|
Apple (37) |
|
|
|
Pear (21) |
|
|
|
Apple (37) |
|
|
|
Pear (21) |
|
|
|
Pear, oriental (1) |
|
|
|
|
|
|
|
Apple (37) |
|
|
|
Pear (21) |
|
|
|
Apple (37) |
|
|
|
Pear (21) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) |
|
|
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07B : Bushberry subgroup (13) |
|
|
|
|
|
|
|
Grape (40) |
|
|
|
Grape (40) |
|
|
|
|
|
|
|
Grape (40) |
|
|
|
Grape (40) |
|
|
|
|
|
|
|
Cranberry (27) |
|
|
|
|
|
|
|
Cranberry (27) |
|
|
|
Cranberry (27) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) |
|
|
|
|
|
|
|
|
|
|
|
Peanut, hay (19) |
|
|
|
|
|
|
|
Alfalfa (21) |
|
 |
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
indoxacarb [CHEBI:38630] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
indoxacarb [CHEBI:38630] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
indoxacarb [CHEBI:38630] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
indoxacarb [CHEBI:38630] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
indoxacarb [CHEBI:38630] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:38630] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
38630 |
| ChEBI InChI Value: |
InChI=1S/C22H17ClF3N3O7/c1-33-18(30)21-10-12-9-13(23)3-8-16(12)17(21)27-28(11-35-21)19(31)29(20(32)34-2)14-4-6-15(7-5-14)36-22(24,25)26/h3-9H,10-11H2,1-2H3/t21-/m0/s1 |
| ChEBI InChIKey Value: |
VBCVPMMZEGZULK-NRFANRHFSA-N |
| ChEBI Compound Name: |
indoxacarb |
| ChEBI SMILES Value: |
COC(=O)N(C(=O)N1CO[C@]2(Cc3cc(Cl)ccc3C2=N1)C(=O)OC)c1ccc(OC(F)(F)F)cc1 |
| ChEBI Substance ID: |
24775800 |
| ChEBI URL: |
ChEBI:38630 |
| ChemSpider ID: |
96889 |
| Ontomatica Chemical Accession Key (OnChAKey): |
VBCVPMMZEGZULK_NRFANRHFSA_N_000_000000 |
| PubChem Compound ID: |
107720 |