Select any link to see items in a related category.
more general categories information about this item 03. Biological Effects of Specific Chemicals 03. Biological Effects of Specific Chemicals xenobiotic [CHEBI:35703] (25) synthetic auxin [CHEBI:26841] (6) 1-naphthylacetic acid [CHEBI:32918] (1) 08. Chemical Category 08. Chemical Category main group molecular entity [CHEBI:33579] (25650) s-block molecular entity [CHEBI:33674] (7287) hydrogen molecular entity [CHEBI:33608] (6932) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) naphthylacetic acid [CHEBI:35629] (1) 1-naphthylacetic acid [CHEBI:32918] (1) p-block molecular entity [CHEBI:33675] (25343) chalcogen molecular entity [CHEBI:33304] (15225) oxygen molecular entity [CHEBI:25806] (14414) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) naphthylacetic acid [CHEBI:35629] (1) 1-naphthylacetic acid [CHEBI:32918] (1) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) naphthylacetic acid [CHEBI:35629] (1) 1-naphthylacetic acid [CHEBI:32918] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) naphthylacetic acid [CHEBI:35629] (1) 1-naphthylacetic acid [CHEBI:32918] (1) organochalcogen compound [CHEBI:36962] (11874) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) naphthylacetic acid [CHEBI:35629] (1) 1-naphthylacetic acid [CHEBI:32918] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) naphthylacetic acid [CHEBI:35629] (1) 1-naphthylacetic acid [CHEBI:32918] (1) carbon group molecular entity [CHEBI:33582] (23847) organic molecular entity [CHEBI:50860] (23769) heteroorganic entity [CHEBI:33285] (15197) organochalcogen compound [CHEBI:36962] (11874) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) naphthylacetic acid [CHEBI:35629] (1) 1-naphthylacetic acid [CHEBI:32918] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) naphthylacetic acid [CHEBI:35629] (1) 1-naphthylacetic acid [CHEBI:32918] (1) organic acid [CHEBI:64709] (3008) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) naphthylacetic acid [CHEBI:35629] (1) 1-naphthylacetic acid [CHEBI:32918] (1) organic molecule [CHEBI:72695] (11399) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) naphthylacetic acid [CHEBI:35629] (1) 1-naphthylacetic acid [CHEBI:32918] (1) polyatomic entity [CHEBI:36357] (18777) molecule [CHEBI:25367] (11520) organic molecule [CHEBI:72695] (11399) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) naphthylacetic acid [CHEBI:35629] (1) 1-naphthylacetic acid [CHEBI:32918] (1) heteroatomic molecular entity [CHEBI:37577] (13672) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) naphthylacetic acid [CHEBI:35629] (1) 1-naphthylacetic acid [CHEBI:32918] (1) ChEBI Compound Accession Identifier: [CHEBI:32918] ChEBI Compound Description: null ChEBI Compound Identification Number: 32918 ChEBI InChI Value: InChI=1S/C12H10O2/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H,13,14) ChEBI InChIKey Value: PRPINYUDVPFIRX-UHFFFAOYSA-N ChEBI Compound Name: 1-naphthylacetic acid ChEBI SMILES Value: OC(=O)Cc1cccc2ccccc12 ChEBI Substance ID: 8145294 ChEBI URL: ChEBI:32918 ChemSpider ID: NS Ontomatica Chemical Accession Key (OnChAKey): PRPINYUDVPFIRX_UHFFFAOYSA_N_000_000000 PubChem Compound ID: 6862
