New Search

Item 3 of 6 (back to results)
Previous previous next Next

1-naphthylacetic acid
null


Current search:

03. Biological Effects of Specific Chemicals: xenobiotic [CHEBI:35703] > synthetic auxin [CHEBI:26841]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 xenobiotic [CHEBI:35703] (25) 
 synthetic auxin [CHEBI:26841] (6) 
 1-naphthylacetic acid [CHEBI:32918] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 naphthylacetic acid [CHEBI:35629] (1) 
 1-naphthylacetic acid [CHEBI:32918] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 naphthylacetic acid [CHEBI:35629] (1) 
 1-naphthylacetic acid [CHEBI:32918] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 naphthylacetic acid [CHEBI:35629] (1) 
 1-naphthylacetic acid [CHEBI:32918] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 naphthylacetic acid [CHEBI:35629] (1) 
 1-naphthylacetic acid [CHEBI:32918] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 naphthylacetic acid [CHEBI:35629] (1) 
 1-naphthylacetic acid [CHEBI:32918] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 naphthylacetic acid [CHEBI:35629] (1) 
 1-naphthylacetic acid [CHEBI:32918] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 naphthylacetic acid [CHEBI:35629] (1) 
 1-naphthylacetic acid [CHEBI:32918] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 naphthylacetic acid [CHEBI:35629] (1) 
 1-naphthylacetic acid [CHEBI:32918] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 naphthylacetic acid [CHEBI:35629] (1) 
 1-naphthylacetic acid [CHEBI:32918] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 naphthylacetic acid [CHEBI:35629] (1) 
 1-naphthylacetic acid [CHEBI:32918] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 naphthylacetic acid [CHEBI:35629] (1) 
 1-naphthylacetic acid [CHEBI:32918] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 naphthylacetic acid [CHEBI:35629] (1) 
 1-naphthylacetic acid [CHEBI:32918] (1)
ChEBI Compound Accession Identifier  [CHEBI:32918]
ChEBI Compound Description  null
ChEBI Compound Identification Number  32918
ChEBI InChI Value  InChI=1S/C12H10O2/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H,13,14)
ChEBI InChIKey Value  PRPINYUDVPFIRX-UHFFFAOYSA-N
ChEBI Compound Name  1-naphthylacetic acid
ChEBI SMILES Value  OC(=O)Cc1cccc2ccccc12
ChEBI Substance ID  8145294
ChEBI URL  ChEBI:32918
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  PRPINYUDVPFIRX_UHFFFAOYSA_N_000_000000
PubChem Compound ID  6862