| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
 |
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methyltestosterone [CHEBI:27436] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:27436] |
| ChEBI Compound Description: |
A 17beta-hydroxy steroid that is testosterone bearing a methyl group at the 17alpha position. |
| ChEBI Compound Identification Number: |
27436 |
| ChEBI InChI Value: |
InChI=1S/C20H30O2/c1-18-9-6-14(21)12-13(18)4-5-15-16(18)7-10-19(2)17(15)8-11-20(19,3)22/h12,15-17,22H,4-11H2,1-3H3/t15-,16+,17+,18+,19+,20+/m1/s1 |
| ChEBI InChIKey Value: |
GCKMFJBGXUYNAG-HLXURNFRSA-N |
| ChEBI Compound Name: |
methyltestosterone |
| ChEBI SMILES Value: |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1(C)O |
| ChEBI Substance ID: |
124403622 |
| ChEBI URL: |
ChEBI:27436 |
| ChemSpider ID: |
5788 |
| Ontomatica Chemical Accession Key (OnChAKey): |
GCKMFJBGXUYNAG_HLXURNFRSA_N_000_000000 |
| PubChem Compound ID: |
6010 |