Item 4 of 17 (back to results) previous next 4-hydroxy-6-methylaniline "An aniline derivative carrying 4-hydroxy and 6-methyl substituents; a urinary metabolite of lidocaine."

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > drug metabolite [CHEBI:49103] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   drug metabolite [CHEBI:49103] (17)   4-hydroxy-6-methylaniline [CHEBI:55546] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  phenols [CHEBI:33853] (868)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  phenols [CHEBI:33853] (868)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  phenols [CHEBI:33853] (868)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  phenols [CHEBI:33853] (868)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   4-hydroxy-6-methylaniline [CHEBI:55546] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   4-hydroxy-6-methylaniline [CHEBI:55546] (1) ChEBI Compound Accession Identifier:   [CHEBI:55546] ChEBI Compound Description:   "An aniline derivative carrying 4-hydroxy and 6-methyl substituents; a urinary metabolite of lidocaine." ChEBI Compound Identification Number:   55546 ChEBI InChI Value:   InChI=1S/C7H9NO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,8H2,1H3 ChEBI InChIKey Value:   QGNGOGOOPUYKMC-UHFFFAOYSA-N ChEBI Compound Name:   4-hydroxy-6-methylaniline ChEBI SMILES Value:   Cc1cc(O)ccc1N ChEBI Substance ID:   92741098 ChEBI URL:   ChEBI:55546 ChemSpider ID:   16838 Ontomatica Chemical Accession Key (OnChAKey):   QGNGOGOOPUYKMC_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   17819