Item 4 of 52 (back to results) previous next ketanserin A member of the class of quinazolines that is quinazoline-2,4(1H,3H)-dione which is substituted at position 3 by a 2-[4-(p-fluorobenzoyl)piperidin-1-yl]ethyl group.

Current search: 03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > neurotransmitter agent [CHEBI:35942] > serotonergic drug [CHEBI:48278] > serotonergic antagonist [CHEBI:48279] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   adrenergic agent [CHEBI:37962] (143)   adrenergic antagonist [CHEBI:37887] (75)   alpha-adrenergic antagonist [CHEBI:37890] (28)   ketanserin [CHEBI:6123] (1)  serotonergic drug [CHEBI:48278] (109)   serotonergic antagonist [CHEBI:48279] (52)   ketanserin [CHEBI:6123] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antihypertensive agent [CHEBI:35674] (104)   ketanserin [CHEBI:6123] (1)  cardiovascular drug [CHEBI:35554] (162)   ketanserin [CHEBI:6123] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   fluorine molecular entity [CHEBI:24062] (288)   organofluorine compound [CHEBI:37143] (275)   ketanserin [CHEBI:6123] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   ketanserin [CHEBI:6123] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   ketanserin [CHEBI:6123] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   ketanserin [CHEBI:6123] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   ketanserin [CHEBI:6123] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   ketanserin [CHEBI:6123] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   ketanserin [CHEBI:6123] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   ketanserin [CHEBI:6123] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   ketanserin [CHEBI:6123] (1)  organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   ketanserin [CHEBI:6123] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   ketanserin [CHEBI:6123] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   ketanserin [CHEBI:6123] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   ketanserin [CHEBI:6123] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   ketanserin [CHEBI:6123] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   ketanserin [CHEBI:6123] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   ketanserin [CHEBI:6123] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   ketanserin [CHEBI:6123] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   ketanserin [CHEBI:6123] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   ketanserin [CHEBI:6123] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   ketanserin [CHEBI:6123] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   ketanserin [CHEBI:6123] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   ketanserin [CHEBI:6123] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   ketanserin [CHEBI:6123] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   ketanserin [CHEBI:6123] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   ketanserin [CHEBI:6123] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   ketanserin [CHEBI:6123] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   ketanserin [CHEBI:6123] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   ketanserin [CHEBI:6123] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   ketanserin [CHEBI:6123] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinazolines [CHEBI:38530] (18)   ketanserin [CHEBI:6123] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   ketanserin [CHEBI:6123] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   ketanserin [CHEBI:6123] (1) ChEBI Compound Accession Identifier:   [CHEBI:6123] ChEBI Compound Description:   A member of the class of quinazolines that is quinazoline-2,4(1H,3H)-dione which is substituted at position 3 by a 2-[4-(p-fluorobenzoyl)piperidin-1-yl]ethyl group. ChEBI Compound Identification Number:   6123 ChEBI InChI Value:   InChI=1S/C22H22FN3O3/c23-17-7-5-15(6-8-17)20(27)16-9-11-25(12-10-16)13-14-26-21(28)18-3-1-2-4-19(18)24-22(26)29/h1-8,16H,9-14H2,(H,24,29) ChEBI InChIKey Value:   FPCCSQOGAWCVBH-UHFFFAOYSA-N ChEBI Compound Name:   ketanserin ChEBI SMILES Value:   Fc1ccc(cc1)C(=O)C1CCN(CC1)CCn1c(=O)[nH]c2ccccc2c1=O ChEBI Substance ID:   49658635 ChEBI URL:   ChEBI:6123 ChemSpider ID:   3690 Ontomatica Chemical Accession Key (OnChAKey):   FPCCSQOGAWCVBH_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   3822