| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
etorphine [CHEBI:4912] (1) |
|
 |
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
etorphine [CHEBI:4912] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
etorphine [CHEBI:4912] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
etorphine [CHEBI:4912] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
etorphine [CHEBI:4912] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
etorphine [CHEBI:4912] (1) |
|
|
|
|
|
|
|
etorphine [CHEBI:4912] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
etorphine [CHEBI:4912] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:4912] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
4912 |
| ChEBI InChI Value: |
InChI=1S/C25H33NO3/c1-5-9-22(2,27)18-15-23-10-11-25(18,28-4)21-24(23)12-13-26(3)19(23)14-16-7-6-8-17(29-21)20(16)24/h6-8,10-11,18-19,21,27H,5,9,12-15H2,1-4H3/t18-,19-,21-,22-,23-,24+,25-/m1/s1 |
| ChEBI InChIKey Value: |
QRHQPCRIZNMZIZ-MASJHSKDSA-N |
| ChEBI Compound Name: |
etorphine |
| ChEBI SMILES Value: |
[H][C@@]1(C[C@]23C=C[C@]1(OC)[C@@H]1Oc4cccc5C[C@H]2N(C)CC[C@@]31c45)[C@](C)(O)CCC |
| ChEBI Substance ID: |
56394826 |
| ChEBI URL: |
ChEBI:4912 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
QRHQPCRIZNMZIZ_MASJHSKDSA_N_000_000000 |
| PubChem Compound ID: |
25058163 |