Item 6 of 6 (back to results) previous 2,4-DB A monocarboxylic acid that is butyric acid in which one of the hydrogens at position 4 is replaced by a 2,4-dichlorophenoxy group. A selective post-emergence herbicide.

Current search: 03. Biological Effects of Specific Chemicals: growth regulator [CHEBI:39317] > plant growth regulator [CHEBI:26155] > auxin [CHEBI:22676] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  growth regulator [CHEBI:39317] (34)   plant growth regulator [CHEBI:26155] (21)   auxin [CHEBI:22676] (6)   2,4-DB [CHEBI:73173] (1) 05. Industrial Uses  05. Industrial Uses  pesticide [CHEBI:25944] (211)   herbicide [CHEBI:24527] (48)   2,4-DB [CHEBI:73173] (1)  agrochemical [CHEBI:33286] (142)   2,4-DB [CHEBI:73173] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,4-DB [CHEBI:73173] (1)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   2,4-DB [CHEBI:73173] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   2,4-DB [CHEBI:73173] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,4-DB [CHEBI:73173] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   2,4-DB [CHEBI:73173] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,4-DB [CHEBI:73173] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,4-DB [CHEBI:73173] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   2,4-DB [CHEBI:73173] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,4-DB [CHEBI:73173] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,4-DB [CHEBI:73173] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   2,4-DB [CHEBI:73173] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   2,4-DB [CHEBI:73173] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,4-DB [CHEBI:73173] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,4-DB [CHEBI:73173] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,4-DB [CHEBI:73173] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   2,4-DB [CHEBI:73173] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,4-DB [CHEBI:73173] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   2,4-DB [CHEBI:73173] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   2,4-DB [CHEBI:73173] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   2,4-DB [CHEBI:73173] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,4-DB [CHEBI:73173] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   2,4-DB [CHEBI:73173] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   2,4-DB [CHEBI:73173] (1) ChEBI Compound Accession Identifier:   [CHEBI:73173] ChEBI Compound Description:   A monocarboxylic acid that is butyric acid in which one of the hydrogens at position 4 is replaced by a 2,4-dichlorophenoxy group. A selective post-emergence herbicide. ChEBI Compound Identification Number:   73173 ChEBI InChI Value:   InChI=1S/C10H10Cl2O3/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14/h3-4,6H,1-2,5H2,(H,13,14) ChEBI InChIKey Value:   YIVXMZJTEQBPQO-UHFFFAOYSA-N ChEBI Compound Name:   2,4-DB ChEBI SMILES Value:   OC(=O)CCCOc1ccc(Cl)cc1Cl ChEBI Substance ID:   162169161 ChEBI URL:   ChEBI:73173 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   YIVXMZJTEQBPQO_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   1489