Item 8 of 24 (back to results) previous next ochratoxin A A phenylalanine derivative resulting from the formal condensation of the amino group of L-phenylalanine with the carboxy group of (3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-2-benzopyran-7-carboxylic acid. It is among the most widely occurring food-contaminating mycotoxins, produced by Aspergillus ochraceus, Aspergillus carbonarius and Penicillium verrucosum.

Current search: 03. Biological Effects of Specific Chemicals: biophysical uses [CHEBI:52208] > membrane transport modulator [CHEBI:38632] > calcium channel modulator [CHEBI:38808] > calcium channel blocker [CHEBI:38215] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   toxin [CHEBI:27026] (45)   mycotoxin [CHEBI:25442] (17)   ochratoxin A [CHEBI:7719] (1)  biophysical uses [CHEBI:52208] (136)   membrane transport modulator [CHEBI:38632] (122)   calcium channel modulator [CHEBI:38808] (32)   calcium channel blocker [CHEBI:38215] (24)   ochratoxin A [CHEBI:7719] (1)  aetiopathogenetic uses [CHEBI:52209] (178)   carcinogenic agent [CHEBI:50903] (40)   ochratoxin A [CHEBI:7719] (1)  teratogenic agent [CHEBI:50905] (12)   ochratoxin A [CHEBI:7719] (1)  poison [CHEBI:64909] (7)   nephrotoxin [CHEBI:61015] (5)   ochratoxin A [CHEBI:7719] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   ochratoxin A [CHEBI:7719] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   ochratoxin A [CHEBI:7719] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   ochratoxin A [CHEBI:7719] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   ochratoxin A [CHEBI:7719] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  carboxamide [CHEBI:37622] (1381)   ochratoxin A [CHEBI:7719] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  carboxamide [CHEBI:37622] (1381)   ochratoxin A [CHEBI:7719] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   ochratoxin A [CHEBI:7719] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   ochratoxin A [CHEBI:7719] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  carboxamide [CHEBI:37622] (1381)   ochratoxin A [CHEBI:7719] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   2-benzopyran [CHEBI:38444] (21)   isochromanes [CHEBI:38762] (10)   ochratoxin A [CHEBI:7719] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   ochratoxin A [CHEBI:7719] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   ochratoxin A [CHEBI:7719] (1) ChEBI Compound Accession Identifier:   [CHEBI:7719] ChEBI Compound Description:   A phenylalanine derivative resulting from the formal condensation of the amino group of L-phenylalanine with the carboxy group of (3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-2-benzopyran-7-carboxylic acid. It is among the most widely occurring food-contaminating mycotoxins, produced by Aspergillus ochraceus, Aspergillus carbonarius and Penicillium verrucosum. ChEBI Compound Identification Number:   7719 ChEBI InChI Value:   InChI=1S/C20H18ClNO6/c1-10-7-12-14(21)9-13(17(23)16(12)20(27)28-10)18(24)22-15(19(25)26)8-11-5-3-2-4-6-11/h2-6,9-10,15,23H,7-8H2,1H3,(H,22,24)(H,25,26)/t10-,15+/m1/s1 ChEBI InChIKey Value:   RWQKHEORZBHNRI-BMIGLBTASA-N ChEBI Compound Name:   ochratoxin A ChEBI SMILES Value:   C[C@@H]1Cc2c(Cl)cc(C(=O)N[C@@H](Cc3ccccc3)C(O)=O)c(O)c2C(=O)O1 ChEBI Substance ID:   24712295 ChEBI URL:   ChEBI:7719 ChemSpider ID:   390954 Ontomatica Chemical Accession Key (OnChAKey):   RWQKHEORZBHNRI_BMIGLBTASA_N_000_000000 PubChem Compound ID:   442530