Item 10 of 17 (back to results) previous next alternariol A benzochromenone that is 6H-benzo[c]chromen-6-one which is substituted by a methyl group at position 1 and by hydroxy groups at positions 3, 7, and 9. It is the most important mycotoxin produced by the black mould Alternaria species, which are the most common mycoflora infecting small grain cereals worldwide.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > metabolite [CHEBI:25212] > secondary metabolite [CHEBI:26619] > toxin [CHEBI:27026] > mycotoxin [CHEBI:25442] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   cholinesterase inhibitor [CHEBI:37733] (52)   alternariol [CHEBI:64983] (1)  metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   alternariol [CHEBI:64983] (1)  toxin [CHEBI:27026] (45)   mycotoxin [CHEBI:25442] (17)   alternariol [CHEBI:64983] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   alternariol [CHEBI:64983] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   alternariol [CHEBI:64983] (1)  organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   alternariol [CHEBI:64983] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   alternariol [CHEBI:64983] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   alternariol [CHEBI:64983] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   alternariol [CHEBI:64983] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   alternariol [CHEBI:64983] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   benzochromene [CHEBI:38920] (4)   benzochromenone [CHEBI:64986] (2)   alternariol [CHEBI:64983] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   alternariol [CHEBI:64983] (1) ChEBI Compound Accession Identifier:   [CHEBI:64983] ChEBI Compound Description:   A benzochromenone that is 6H-benzo[c]chromen-6-one which is substituted by a methyl group at position 1 and by hydroxy groups at positions 3, 7, and 9. It is the most important mycotoxin produced by the black mould Alternaria species, which are the most common mycoflora infecting small grain cereals worldwide. ChEBI Compound Identification Number:   64983 ChEBI InChI Value:   InChI=1S/C14H10O5/c1-6-2-7(15)5-11-12(6)9-3-8(16)4-10(17)13(9)14(18)19-11/h2-5,15-17H,1H3 ChEBI InChIKey Value:   CEBXXEKPIIDJHL-UHFFFAOYSA-N ChEBI Compound Name:   alternariol ChEBI SMILES Value:   Cc1cc(O)cc2oc(=O)c3c(O)cc(O)cc3c12 ChEBI Substance ID:   136349147 ChEBI URL:   ChEBI:64983 ChemSpider ID:   4514301 Ontomatica Chemical Accession Key (OnChAKey):   CEBXXEKPIIDJHL_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   5359485