Select any link to see items in a related category.

more general categories	information about this item
03. Biological Effects of Specific Chemicals	03. Biological Effects of Specific Chemicals
biochemical uses [CHEBI:52206] (3306)
enzyme inhibitor [CHEBI:23924] (825)
electron-transport chain inhibitor [CHEBI:38496] (27)
respiratory-chain inhibitor [CHEBI:38497] (23)
mitochondrial respiratory-chain inhibitor [CHEBI:25355] (18)
mitochondrial cytochrome-bc1 complex inhibitor [CHEBI:38499] (3)	fluacrypyrim [CHEBI:38591] (1)
08. Chemical Category	08. Chemical Category
main group molecular entity [CHEBI:33579] (25650)
p-block molecular entity [CHEBI:33675] (25343)
halogen molecular entity [CHEBI:24471] (1475)
fluorine molecular entity [CHEBI:24062] (288)
organofluorine compound [CHEBI:37143] (275)
organofluorine pesticide [CHEBI:38805] (18)
organofluorine acaricide [CHEBI:38806] (9)	fluacrypyrim [CHEBI:38591] (1)
halide [CHEBI:37578] (1402)
organohalogen compound [CHEBI:36684] (976)
organofluorine compound [CHEBI:37143] (275)
organofluorine pesticide [CHEBI:38805] (18)
organofluorine acaricide [CHEBI:38806] (9)	fluacrypyrim [CHEBI:38591] (1)
pnictogen molecular entity [CHEBI:33302] (10027)
nitrogen molecular entity [CHEBI:51143] (7930)
organonitrogen compound [CHEBI:35352] (6705)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	fluacrypyrim [CHEBI:38591] (1)
carbon group molecular entity [CHEBI:33582] (23847)
organic molecular entity [CHEBI:50860] (23769)
heteroorganic entity [CHEBI:33285] (15197)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	fluacrypyrim [CHEBI:38591] (1)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	fluacrypyrim [CHEBI:38591] (1)
organonitrogen compound [CHEBI:35352] (6705)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	fluacrypyrim [CHEBI:38591] (1)
organohalogen compound [CHEBI:36684] (976)
organofluorine compound [CHEBI:37143] (275)
organofluorine pesticide [CHEBI:38805] (18)
organofluorine acaricide [CHEBI:38806] (9)	fluacrypyrim [CHEBI:38591] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	fluacrypyrim [CHEBI:38591] (1)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	fluacrypyrim [CHEBI:38591] (1)
polyatomic entity [CHEBI:36357] (18777)
molecule [CHEBI:25367] (11520)
cyclic compound [CHEBI:33595] (7817)
monocyclic compound [CHEBI:33661] (2007)
heteromonocyclic compound [CHEBI:33670] (2004)
organic heteromonocyclic compound [CHEBI:25693] (2004)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	fluacrypyrim [CHEBI:38591] (1)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	fluacrypyrim [CHEBI:38591] (1)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	fluacrypyrim [CHEBI:38591] (1)
heterocyclic compound [CHEBI:5686] (5275)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	fluacrypyrim [CHEBI:38591] (1)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	fluacrypyrim [CHEBI:38591] (1)
heteromonocyclic compound [CHEBI:33670] (2004)
organic heteromonocyclic compound [CHEBI:25693] (2004)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	fluacrypyrim [CHEBI:38591] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	fluacrypyrim [CHEBI:38591] (1)
organonitrogen heterocyclic compound [CHEBI:38101] (3202)
diazines [CHEBI:38313] (288)
pyrimidines [CHEBI:39447] (260)	fluacrypyrim [CHEBI:38591] (1)
heteroatomic molecular entity [CHEBI:37577] (13672)
halide [CHEBI:37578] (1402)
organohalogen compound [CHEBI:36684] (976)
organofluorine compound [CHEBI:37143] (275)
organofluorine pesticide [CHEBI:38805] (18)
organofluorine acaricide [CHEBI:38806] (9)	fluacrypyrim [CHEBI:38591] (1)
ChEBI Compound Accession Identifier:	[CHEBI:38591]
ChEBI Compound Description:	null
ChEBI Compound Identification Number:	38591
ChEBI InChI Value:	InChI=1S/C20H21F3N2O5/c1-12(2)30-19-24-16(20(21,22)23)9-17(25-19)29-10-13-7-5-6-8-14(13)15(11-27-3)18(26)28-4/h5-9,11-12H,10H2,1-4H3/b15-11+
ChEBI InChIKey Value:	MXWAGQASUDSFBG-RVDMUPIBSA-N
ChEBI Compound Name:	fluacrypyrim
ChEBI SMILES Value:	CO\C=C(\C(=O)OC)c1ccccc1COc1cc(nc(OC(C)C)n1)C(F)(F)F
ChEBI Substance ID:	24775854
ChEBI URL:	ChEBI:38591
ChemSpider ID:	8129795
Ontomatica Chemical Accession Key (OnChAKey):	MXWAGQASUDSFBG_RVDMUPIBSA_N_000_000000
PubChem Compound ID:	9954185