Item 1 of 1 (back to results) FR177391 A 14-membered macrolide isolated from the Serratia liquefaciens and exhibits anti-hyperlipidemic activity.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > antilipemic drug [CHEBI:35679] > FR177391 [CHEBI:65911] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   FR177391 [CHEBI:65911] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antilipemic drug [CHEBI:35679] (30)   FR177391 [CHEBI:65911] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   FR177391 [CHEBI:65911] (1)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   FR177391 [CHEBI:65911] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   FR177391 [CHEBI:65911] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   FR177391 [CHEBI:65911] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   FR177391 [CHEBI:65911] (1)  polyketide [CHEBI:26188] (172)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  acetate ester [CHEBI:47622] (184)   FR177391 [CHEBI:65911] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  cyclic ether [CHEBI:37407] (314)   FR177391 [CHEBI:65911] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   FR177391 [CHEBI:65911] (1)  polyketide [CHEBI:26188] (172)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  acetate ester [CHEBI:47622] (184)   FR177391 [CHEBI:65911] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  cyclic ether [CHEBI:37407] (314)   FR177391 [CHEBI:65911] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  cyclic ether [CHEBI:37407] (314)   FR177391 [CHEBI:65911] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   FR177391 [CHEBI:65911] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   FR177391 [CHEBI:65911] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   FR177391 [CHEBI:65911] (1)  polyketide [CHEBI:26188] (172)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  acetate ester [CHEBI:47622] (184)   FR177391 [CHEBI:65911] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  cyclic ether [CHEBI:37407] (314)   FR177391 [CHEBI:65911] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   FR177391 [CHEBI:65911] (1)  ester [CHEBI:35701] (3370)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  acetate ester [CHEBI:47622] (184)   FR177391 [CHEBI:65911] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  cyclic ether [CHEBI:37407] (314)   FR177391 [CHEBI:65911] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   FR177391 [CHEBI:65911] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  acetate ester [CHEBI:47622] (184)   FR177391 [CHEBI:65911] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   FR177391 [CHEBI:65911] (1)  bridged compound [CHEBI:35990] (118)   FR177391 [CHEBI:65911] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   FR177391 [CHEBI:65911] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  cyclic ether [CHEBI:37407] (314)   FR177391 [CHEBI:65911] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   FR177391 [CHEBI:65911] (1)  macrocycle [CHEBI:51026] (234)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  cyclic ether [CHEBI:37407] (314)   FR177391 [CHEBI:65911] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   FR177391 [CHEBI:65911] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   FR177391 [CHEBI:65911] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   FR177391 [CHEBI:65911] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  cyclic ether [CHEBI:37407] (314)   FR177391 [CHEBI:65911] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   FR177391 [CHEBI:65911] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   macrocyclic lactone [CHEBI:63944] (96)   macrolide [CHEBI:25106] (78)   FR177391 [CHEBI:65911] (1)  acetate ester [CHEBI:47622] (184)   FR177391 [CHEBI:65911] (1)  carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   FR177391 [CHEBI:65911] (1)  alcohol [CHEBI:30879] (1371)   secondary alcohol [CHEBI:35681] (342)   FR177391 [CHEBI:65911] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   FR177391 [CHEBI:65911] (1) ChEBI Compound Accession Identifier:   [CHEBI:65911] ChEBI Compound Description:   A 14-membered macrolide isolated from the Serratia liquefaciens and exhibits anti-hyperlipidemic activity. ChEBI Compound Identification Number:   65911 ChEBI InChI Value:   InChI=1S/C23H31ClO8/c1-13(10-21(27)28)9-18(26)23-20-11-17(31-23)8-7-16(24)6-4-5-14(2)19(30-15(3)25)12-22(29)32-20/h5-6,9,17-20,23,26H,4,7-8,10-12H2,1-3H3,(H,27,28)/b13-9+,14-5-,16-6-/t17-,18-,19-,20-,23-/m1/s1 ChEBI InChIKey Value:   OAWOFENLLWPBEQ-VXLXENEISA-N ChEBI Compound Name:   FR177391 ChEBI SMILES Value:   [H][C@@]1(O[C@@H]2CC\C(Cl)=C\C\C=C(C)/[C@@H](CC(=O)O[C@@H]1C2)OC(C)=O)[C@H](O)\C=C(/C)CC(O)=O ChEBI Substance ID:   160709617 ChEBI URL:   ChEBI:65911 ChemSpider ID:   28283131 Ontomatica Chemical Accession Key (OnChAKey):   OAWOFENLLWPBEQ_VXLXENEISA_N_000_000000 PubChem Compound ID:   11123535