Item 1 of 1 (back to results) dyclonine N-Ethylpiperidine in which one of the hydrogens attached to the methyl group is substituted by a 4-butoxybenzoyl group.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > anaesthetic [CHEBI:38867] > local anaesthetic [CHEBI:36333] > topical anaesthetic [CHEBI:48425] > dyclonine [CHEBI:4724] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   anaesthetic [CHEBI:38867] (64)   local anaesthetic [CHEBI:36333] (35)   topical anaesthetic [CHEBI:48425] (4)   dyclonine [CHEBI:4724] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   dyclonine [CHEBI:4724] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dyclonine [CHEBI:4724] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dyclonine [CHEBI:4724] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   dyclonine [CHEBI:4724] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   dyclonine [CHEBI:4724] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   dyclonine [CHEBI:4724] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dyclonine [CHEBI:4724] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   dyclonine [CHEBI:4724] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   dyclonine [CHEBI:4724] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dyclonine [CHEBI:4724] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   dyclonine [CHEBI:4724] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   dyclonine [CHEBI:4724] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   dyclonine [CHEBI:4724] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   dyclonine [CHEBI:4724] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   dyclonine [CHEBI:4724] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   dyclonine [CHEBI:4724] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   dyclonine [CHEBI:4724] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   dyclonine [CHEBI:4724] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   dyclonine [CHEBI:4724] (1) ChEBI Compound Accession Identifier:   [CHEBI:4724] ChEBI Compound Description:   N-Ethylpiperidine in which one of the hydrogens attached to the methyl group is substituted by a 4-butoxybenzoyl group. ChEBI Compound Identification Number:   4724 ChEBI InChI Value:   InChI=1S/C18H27NO2/c1-2-3-15-21-17-9-7-16(8-10-17)18(20)11-14-19-12-5-4-6-13-19/h7-10H,2-6,11-15H2,1H3 ChEBI InChIKey Value:   BZEWSEKUUPWQDQ-UHFFFAOYSA-N ChEBI Compound Name:   dyclonine ChEBI SMILES Value:   CCCCOc1ccc(cc1)C(=O)CCN1CCCCC1 ChEBI Substance ID:   99319105 ChEBI URL:   ChEBI:4724 ChemSpider ID:   3068 Ontomatica Chemical Accession Key (OnChAKey):   BZEWSEKUUPWQDQ_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   3180