Item 1 of 1 (back to results) aceprometazine A phenothiazine compound having an acetyl group at the 2-position and a 2-(dimethylamino)-1-propyl group at the 10-position.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > central nervous system drug [CHEBI:35470] > psychotropic drug [CHEBI:35471] > tranquilizing drug [CHEBI:35473] > anxiolytic drug [CHEBI:35474] > aceprometazine [CHEBI:53770] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   histaminergic drug [CHEBI:37957] (94)   histamine antagonist [CHEBI:37956] (87)   aceprometazine [CHEBI:53770] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   central nervous system drug [CHEBI:35470] (217)   psychotropic drug [CHEBI:35471] (130)   tranquilizing drug [CHEBI:35473] (83)   anxiolytic drug [CHEBI:35474] (31)   aceprometazine [CHEBI:53770] (1)  central nervous system depressant [CHEBI:35488] (90)   sedative [CHEBI:35717] (43)   aceprometazine [CHEBI:53770] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   amine [CHEBI:32952] (179)   tertiary amine [CHEBI:32876] (84)   aceprometazine [CHEBI:53770] (3)  tertiary amino compound [CHEBI:50996] (199)   tertiary amine [CHEBI:32876] (84)   aceprometazine [CHEBI:53770] (3)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   methyl ketone [CHEBI:51867] (59)   aceprometazine [CHEBI:53770] (3)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   methyl ketone [CHEBI:51867] (59)   aceprometazine [CHEBI:53770] (3)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   aceprometazine [CHEBI:53770] (3)  organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   amine [CHEBI:32952] (179)   tertiary amine [CHEBI:32876] (84)   aceprometazine [CHEBI:53770] (3)  tertiary amino compound [CHEBI:50996] (199)   tertiary amine [CHEBI:32876] (84)   aceprometazine [CHEBI:53770] (3)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   methyl ketone [CHEBI:51867] (59)   aceprometazine [CHEBI:53770] (3)  organic amino compound [CHEBI:50047] (2472)   amine [CHEBI:32952] (179)   tertiary amine [CHEBI:32876] (84)   aceprometazine [CHEBI:53770] (3)  tertiary amino compound [CHEBI:50996] (199)   tertiary amine [CHEBI:32876] (84)   aceprometazine [CHEBI:53770] (3)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   aceprometazine [CHEBI:53770] (3)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   aceprometazine [CHEBI:53770] (3)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   methyl ketone [CHEBI:51867] (59)   aceprometazine [CHEBI:53770] (3)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   aceprometazine [CHEBI:53770] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   aceprometazine [CHEBI:53770] (3)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   aceprometazine [CHEBI:53770] (3)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   aceprometazine [CHEBI:53770] (3)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   aceprometazine [CHEBI:53770] (3)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   aceprometazine [CHEBI:53770] (3)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   aceprometazine [CHEBI:53770] (3)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   aceprometazine [CHEBI:53770] (3)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   aceprometazine [CHEBI:53770] (3)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   aceprometazine [CHEBI:53770] (3)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   methyl ketone [CHEBI:51867] (59)   aceprometazine [CHEBI:53770] (3) ChEBI Compound Accession Identifier:   [CHEBI:53770] ChEBI Compound Description:   A phenothiazine compound having an acetyl group at the 2-position and a 2-(dimethylamino)-1-propyl group at the 10-position. ChEBI Compound Identification Number:   53770 ChEBI InChI Value:   InChI=1S/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3 ChEBI InChIKey Value:   XLOQNFNTQIRSOX-UHFFFAOYSA-N ChEBI Compound Name:   aceprometazine ChEBI SMILES Value:   CC(CN1c2ccccc2Sc2ccc(cc12)C(C)=O)N(C)C ChEBI Substance ID:   87246629 ChEBI URL:   ChEBI:53770 ChemSpider ID:   24249 Ontomatica Chemical Accession Key (OnChAKey):   XLOQNFNTQIRSOX_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   26035