Item 1 of 1 (back to results) adinazolam A triazolo[4,3-a][1,4]benzodiazepine having a dimethylaminomethyl group at the 1-position, a phenyl group at the 6-position and a chloro substituent at the 8-position.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > central nervous system drug [CHEBI:35470] > central nervous system depressant [CHEBI:35488] > anticonvulsant [CHEBI:35623] > adinazolam [CHEBI:251412] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   central nervous system drug [CHEBI:35470] (217)   psychotropic drug [CHEBI:35471] (130)   tranquilizing drug [CHEBI:35473] (83)   anxiolytic drug [CHEBI:35474] (31)   adinazolam [CHEBI:251412] (1)  central nervous system depressant [CHEBI:35488] (90)   anticonvulsant [CHEBI:35623] (39)   adinazolam [CHEBI:251412] (1)  sedative [CHEBI:35717] (43)   adinazolam [CHEBI:251412] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   triazolobenzodiazepine [CHEBI:35501] (4)   adinazolam [CHEBI:251412] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   triazolobenzodiazepine [CHEBI:35501] (4)   adinazolam [CHEBI:251412] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   triazolobenzodiazepine [CHEBI:35501] (4)   adinazolam [CHEBI:251412] (1)  tricyclic antidepressant [CHEBI:36809] (22)   adinazolam [CHEBI:251412] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   triazolobenzodiazepine [CHEBI:35501] (4)   adinazolam [CHEBI:251412] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   triazolobenzodiazepine [CHEBI:35501] (4)   adinazolam [CHEBI:251412] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   triazolobenzodiazepine [CHEBI:35501] (4)   adinazolam [CHEBI:251412] (1)  tricyclic antidepressant [CHEBI:36809] (22)   adinazolam [CHEBI:251412] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   triazolobenzodiazepine [CHEBI:35501] (4)   adinazolam [CHEBI:251412] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   triazolobenzodiazepine [CHEBI:35501] (4)   adinazolam [CHEBI:251412] (1)  tricyclic antidepressant [CHEBI:36809] (22)   adinazolam [CHEBI:251412] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   triazolobenzodiazepine [CHEBI:35501] (4)   adinazolam [CHEBI:251412] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   triazolobenzodiazepine [CHEBI:35501] (4)   adinazolam [CHEBI:251412] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   triazolobenzodiazepine [CHEBI:35501] (4)   adinazolam [CHEBI:251412] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   triazolobenzodiazepine [CHEBI:35501] (4)   adinazolam [CHEBI:251412] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   triazolobenzodiazepine [CHEBI:35501] (4)   adinazolam [CHEBI:251412] (1)  tricyclic antidepressant [CHEBI:36809] (22)   adinazolam [CHEBI:251412] (1) ChEBI Compound Accession Identifier:   [CHEBI:251412] ChEBI Compound Description:   A triazolo[4,3-a][1,4]benzodiazepine having a dimethylaminomethyl group at the 1-position, a phenyl group at the 6-position and a chloro substituent at the 8-position. ChEBI Compound Identification Number:   251412 ChEBI InChI Value:   InChI=1S/C19H18ClN5/c1-24(2)12-18-23-22-17-11-21-19(13-6-4-3-5-7-13)15-10-14(20)8-9-16(15)25(17)18/h3-10H,11-12H2,1-2H3 ChEBI InChIKey Value:   GJSLOMWRLALDCT-UHFFFAOYSA-N ChEBI Compound Name:   adinazolam ChEBI SMILES Value:   CN(C)Cc1nnc2CN=C(c3ccccc3)c3cc(Cl)ccc3-n12 ChEBI Substance ID:   85444484 ChEBI URL:   ChEBI:251412 ChemSpider ID:   34519 Ontomatica Chemical Accession Key (OnChAKey):   GJSLOMWRLALDCT_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   37632