Item 1 of 1 (back to results) cinolazepam A 1,4-benzodiazepinone compound having a 2-cyanoethyl substituent at the 1-position, a hydroxy substituent at the 3-position, a 2-fluorophenyl group at the 5-position and a chloro substituent at the 7-position, it has general properties similar to those of diazepam and has been used for the short-term management of sleep disorders.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > central nervous system drug [CHEBI:35470] > central nervous system depressant [CHEBI:35488] > sedative [CHEBI:35717] > cinolazepam [CHEBI:59514] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   central nervous system drug [CHEBI:35470] (217)   central nervous system depressant [CHEBI:35488] (90)   anticonvulsant [CHEBI:35623] (39)   cinolazepam [CHEBI:59514] (1)  sedative [CHEBI:35717] (43)   cinolazepam [CHEBI:59514] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   cinolazepam [CHEBI:59514] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   cinolazepam [CHEBI:59514] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   cinolazepam [CHEBI:59514] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzodiazepine [CHEBI:22720] (17)   1,4-benzodiazepinone [CHEBI:35500] (12)   cinolazepam [CHEBI:59514] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   cinolazepam [CHEBI:59514] (1) ChEBI Compound Accession Identifier:   [CHEBI:59514] ChEBI Compound Description:   A 1,4-benzodiazepinone compound having a 2-cyanoethyl substituent at the 1-position, a hydroxy substituent at the 3-position, a 2-fluorophenyl group at the 5-position and a chloro substituent at the 7-position, it has general properties similar to those of diazepam and has been used for the short-term management of sleep disorders. ChEBI Compound Identification Number:   59514 ChEBI InChI Value:   InChI=1S/C18H13ClFN3O2/c19-11-6-7-15-13(10-11)16(12-4-1-2-5-14(12)20)22-17(24)18(25)23(15)9-3-8-21/h1-2,4-7,10,17,24H,3,9H2 ChEBI InChIKey Value:   XAXMYHMKTCNRRZ-UHFFFAOYSA-N ChEBI Compound Name:   cinolazepam ChEBI SMILES Value:   OC1N=C(c2ccccc2F)c2cc(Cl)ccc2N(CCC#N)C1=O ChEBI Substance ID:   93581448 ChEBI URL:   ChEBI:59514 ChemSpider ID:   2298251 Ontomatica Chemical Accession Key (OnChAKey):   XAXMYHMKTCNRRZ_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   3033621