Item 1 of 1 (back to results) cinacalcet A secondary amino compound that is (1R)-1-(naphthalen-1-yl)ethanamine in which one of the hydrogens attached to the nitrogen is substituted by a 3-[3-(trifluoromethyl)phenyl]propyl group.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > calcimimetic [CHEBI:48525] > cinacalcet [CHEBI:48390] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   P450 inhibitor [CHEBI:50183] (13)   cinacalcet [CHEBI:48390] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   calcimimetic [CHEBI:48525] (2)   cinacalcet [CHEBI:48390] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   fluorine molecular entity [CHEBI:24062] (288)   organofluorine compound [CHEBI:37143] (275)   cinacalcet [CHEBI:48390] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   cinacalcet [CHEBI:48390] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   secondary amino compound [CHEBI:50995] (110)   cinacalcet [CHEBI:48390] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   secondary amino compound [CHEBI:50995] (110)   cinacalcet [CHEBI:48390] (1)  organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   cinacalcet [CHEBI:48390] (1)  organic amino compound [CHEBI:50047] (2472)   secondary amino compound [CHEBI:50995] (110)   cinacalcet [CHEBI:48390] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  bicyclic compound [CHEBI:33636] (1511)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   cinacalcet [CHEBI:48390] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   cinacalcet [CHEBI:48390] (1) ChEBI Compound Accession Identifier:   [CHEBI:48390] ChEBI Compound Description:   A secondary amino compound that is (1R)-1-(naphthalen-1-yl)ethanamine in which one of the hydrogens attached to the nitrogen is substituted by a 3-[3-(trifluoromethyl)phenyl]propyl group. ChEBI Compound Identification Number:   48390 ChEBI InChI Value:   InChI=1S/C22H22F3N/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25/h2-5,7,9-13,15-16,26H,6,8,14H2,1H3/t16-/m1/s1 ChEBI InChIKey Value:   VDHAWDNDOKGFTD-MRXNPFEDSA-N ChEBI Compound Name:   cinacalcet ChEBI SMILES Value:   C[C@@H](NCCCc1cccc(c1)C(F)(F)F)c1cccc2ccccc12 ChEBI Substance ID:   49658855 ChEBI URL:   ChEBI:48390 ChemSpider ID:   137743 Ontomatica Chemical Accession Key (OnChAKey):   VDHAWDNDOKGFTD_MRXNPFEDSA_N_000_000000 PubChem Compound ID:   156419