Item 1 of 1 (back to results) roflumilast A benzamide obtained by formal condensation of the carboxy group of 3-(cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid with the amino group of 3,5-dichloropyridin-4-amine. Used for treatment of bronchial asthma and chronic obstructive pulmonary disease.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > anti-asthmatic drug [CHEBI:49167] > roflumilast [CHEBI:47657] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   phosphodiesterase inhibitor [CHEBI:50218] (17)   phosphodiesterase IV inhibitor [CHEBI:68844] (1)   roflumilast [CHEBI:47657] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   anti-asthmatic drug [CHEBI:49167] (25)   roflumilast [CHEBI:47657] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  fluorine molecular entity [CHEBI:24062] (288)   organofluorine compound [CHEBI:37143] (275)   roflumilast [CHEBI:47657] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  organofluorine compound [CHEBI:37143] (275)   roflumilast [CHEBI:47657] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   roflumilast [CHEBI:47657] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   roflumilast [CHEBI:47657] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   roflumilast [CHEBI:47657] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   roflumilast [CHEBI:47657] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   roflumilast [CHEBI:47657] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   roflumilast [CHEBI:47657] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   roflumilast [CHEBI:47657] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  organofluorine compound [CHEBI:37143] (275)   roflumilast [CHEBI:47657] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   roflumilast [CHEBI:47657] (1)  carboxamide [CHEBI:37622] (1381)   monocarboxylic acid amide [CHEBI:29347] (257)   arenecarboxamide [CHEBI:22645] (45)   benzamides [CHEBI:22702] (45)   roflumilast [CHEBI:47657] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  carbocyclic compound [CHEBI:33598] (1130)   cyclopropanes [CHEBI:51454] (58)   roflumilast [CHEBI:47657] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   roflumilast [CHEBI:47657] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   cyclopropanes [CHEBI:51454] (58)   roflumilast [CHEBI:47657] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   roflumilast [CHEBI:47657] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  carbocyclic compound [CHEBI:33598] (1130)   cyclopropanes [CHEBI:51454] (58)   roflumilast [CHEBI:47657] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   roflumilast [CHEBI:47657] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  carbocyclic compound [CHEBI:33598] (1130)   cyclopropanes [CHEBI:51454] (58)   roflumilast [CHEBI:47657] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   roflumilast [CHEBI:47657] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   chloropyridine [CHEBI:39173] (4)   roflumilast [CHEBI:47657] (1)  organofluorine compound [CHEBI:37143] (275)   roflumilast [CHEBI:47657] (1) ChEBI Compound Accession Identifier:   [CHEBI:47657] ChEBI Compound Description:   A benzamide obtained by formal condensation of the carboxy group of 3-(cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid with the amino group of 3,5-dichloropyridin-4-amine. Used for treatment of bronchial asthma and chronic obstructive pulmonary disease. ChEBI Compound Identification Number:   47657 ChEBI InChI Value:   InChI=1S/C17H14Cl2F2N2O3/c18-11-6-22-7-12(19)15(11)23-16(24)10-3-4-13(26-17(20)21)14(5-10)25-8-9-1-2-9/h3-7,9,17H,1-2,8H2,(H,22,23,24) ChEBI InChIKey Value:   MNDBXUUTURYVHR-UHFFFAOYSA-N ChEBI Compound Name:   roflumilast ChEBI SMILES Value:   FC(F)Oc1ccc(cc1OCC1CC1)C(=O)Nc1c(Cl)cncc1Cl ChEBI Substance ID:   160644734 ChEBI URL:   ChEBI:47657 ChemSpider ID:   395793 Ontomatica Chemical Accession Key (OnChAKey):   MNDBXUUTURYVHR_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   449193