Item 1 of 1 (back to results) tazarotenic acid A thiochromene that is acetylene in which the hydrogens are replaced by 5-carboxypyridin-2-yl and 4,4-dimethylthiochroman-6-yl groups. It is the active form of the prodrug tazarotene.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > dermatologic drug [CHEBI:50177] > keratolytic drug [CHEBI:50176] > tazarotenic acid [CHEBI:73129] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  aetiopathogenetic uses [CHEBI:52209] (178)   teratogenic agent [CHEBI:50905] (12)   tazarotenic acid [CHEBI:73129] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   dermatologic drug [CHEBI:50177] (49)   keratolytic drug [CHEBI:50176] (10)   tazarotenic acid [CHEBI:73129] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   tazarotenic acid [CHEBI:73129] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   tazarotenic acid [CHEBI:73129] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   tazarotenic acid [CHEBI:73129] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   tazarotenic acid [CHEBI:73129] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   tazarotenic acid [CHEBI:73129] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   tazarotenic acid [CHEBI:73129] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   tazarotenic acid [CHEBI:73129] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   diterpenoid [CHEBI:23849] (265)   retinoid [CHEBI:26537] (33)   tazarotenic acid [CHEBI:73129] (1)  isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   diterpenoid [CHEBI:23849] (265)   retinoid [CHEBI:26537] (33)   tazarotenic acid [CHEBI:73129] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   tazarotenic acid [CHEBI:73129] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   tazarotenic acid [CHEBI:73129] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   tazarotenic acid [CHEBI:73129] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   tazarotenic acid [CHEBI:73129] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   tazarotenic acid [CHEBI:73129] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   tazarotenic acid [CHEBI:73129] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   tazarotenic acid [CHEBI:73129] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   tazarotenic acid [CHEBI:73129] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   tazarotenic acid [CHEBI:73129] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   tazarotenic acid [CHEBI:73129] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   tazarotenic acid [CHEBI:73129] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   tazarotenic acid [CHEBI:73129] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   tazarotenic acid [CHEBI:73129] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   tazarotenic acid [CHEBI:73129] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   tazarotenic acid [CHEBI:73129] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   tazarotenic acid [CHEBI:73129] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   tazarotenic acid [CHEBI:73129] (1)  oxacycle [CHEBI:38104] (2002)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   benzopyran [CHEBI:22727] (349)   1-benzopyran [CHEBI:38443] (328)   chromenes [CHEBI:23232] (118)   thiochromene [CHEBI:50747] (2)   tazarotenic acid [CHEBI:73129] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   tazarotenic acid [CHEBI:73129] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   tazarotenic acid [CHEBI:73129] (1) ChEBI Compound Accession Identifier:   [CHEBI:73129] ChEBI Compound Description:   A thiochromene that is acetylene in which the hydrogens are replaced by 5-carboxypyridin-2-yl and 4,4-dimethylthiochroman-6-yl groups. It is the active form of the prodrug tazarotene. ChEBI Compound Identification Number:   73129 ChEBI InChI Value:   InChI=1S/C19H17NO2S/c1-19(2)9-10-23-17-8-4-13(11-16(17)19)3-6-15-7-5-14(12-20-15)18(21)22/h4-5,7-8,11-12H,9-10H2,1-2H3,(H,21,22) ChEBI InChIKey Value:   IQIBKLWBVJPOQO-UHFFFAOYSA-N ChEBI Compound Name:   tazarotenic acid ChEBI SMILES Value:   CC1(C)CCSc2ccc(cc12)C#Cc1ccc(cn1)C(O)=O ChEBI Substance ID:   163425915 ChEBI URL:   ChEBI:73129 ChemSpider ID:   130092 Ontomatica Chemical Accession Key (OnChAKey):   IQIBKLWBVJPOQO_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   147525