Item 1 of 1 (back to results) anagrelide A 1,5-dihydroimidazo[2,1-]quinazoline having an oxo substituent at the 2-position and chloro substituents at the 6- and 7-positions.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > hematologic agent [CHEBI:50248] > anticoagulant [CHEBI:50249] > anagrelide [CHEBI:142290] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   fibrin modulating drug [CHEBI:48676] (7)   antifibrinolytic drug [CHEBI:48675] (4)   anagrelide [CHEBI:142290] (1)  hematologic agent [CHEBI:50248] (64)   anticoagulant [CHEBI:50249] (29)   anagrelide [CHEBI:142290] (1)  platelet aggregation inhibitor [CHEBI:50427] (39)   anagrelide [CHEBI:142290] (1)  cardiovascular drug [CHEBI:35554] (162)   anagrelide [CHEBI:142290] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   imidazoquinazoline [CHEBI:47975] (1)   anagrelide [CHEBI:142290] (1) ChEBI Compound Accession Identifier:   [CHEBI:142290] ChEBI Compound Description:   A 1,5-dihydroimidazo[2,1-]quinazoline having an oxo substituent at the 2-position and chloro substituents at the 6- and 7-positions. ChEBI Compound Identification Number:   142290 ChEBI InChI Value:   InChI=1S/C10H7Cl2N3O/c11-6-1-2-7-5(9(6)12)3-15-4-8(16)14-10(15)13-7/h1-2H,3-4H2,(H,13,14,16) ChEBI InChIKey Value:   OTBXOEAOVRKTNQ-UHFFFAOYSA-N ChEBI Compound Name:   anagrelide ChEBI SMILES Value:   Clc1ccc2N=C3NC(=O)CN3Cc2c1Cl ChEBI Substance ID:   85341952 ChEBI URL:   ChEBI:142290 ChemSpider ID:   2097 Ontomatica Chemical Accession Key (OnChAKey):   OTBXOEAOVRKTNQ_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   2182