| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
|
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
 |
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
|
|
2-hydroxy-17beta-estradiol [CHEBI:28744] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:28744] |
| ChEBI Compound Description: |
A 2-hydroxy steroid that consists of 17beta-estradiol having an additional hydroxy group at position 2. |
| ChEBI Compound Identification Number: |
28744 |
| ChEBI InChI Value: |
InChI=1S/C18H24O3/c1-18-7-6-11-12(14(18)4-5-17(18)21)3-2-10-8-15(19)16(20)9-13(10)11/h8-9,11-12,14,17,19-21H,2-7H2,1H3/t11-,12+,14-,17-,18-/m0/s1 |
| ChEBI InChIKey Value: |
DILDHNKDVHLEQB-XSSYPUMDSA-N |
| ChEBI Compound Name: |
2-hydroxy-17beta-estradiol |
| ChEBI SMILES Value: |
[H][C@]12CC[C@]3(C)[C@@H](O)CC[C@@]3([H])[C@]1([H])CCc1cc(O)c(O)cc21 |
| ChEBI Substance ID: |
11533223 |
| ChEBI URL: |
ChEBI:28744 |
| ChemSpider ID: |
216475 |
| Ontomatica Chemical Accession Key (OnChAKey): |
DILDHNKDVHLEQB_XSSYPUMDSA_N_000_000000 |
| PubChem Compound ID: |
247304 |