Item 1 of 1 (back to results) olsalazine An azobenzene that consists of two molecules of 4-aminosalicylic acid joined by an azo linkage. A prodrug for mesalazine, an anti-inflammatory drug, it is used (as the disodium salt) in the treatment of inflammatory bowel disease.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > prodrug [CHEBI:50266] > olsalazine [CHEBI:7770] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   prodrug [CHEBI:50266] (88)   olsalazine [CHEBI:7770] (1)  anti-inflammatory drug [CHEBI:35472] (112)   non-steroidal anti-inflammatory drug [CHEBI:35475] (71)   olsalazine [CHEBI:7770] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   dicarboxylic acid [CHEBI:35692] (312)   olsalazine [CHEBI:7770] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   azo compound [CHEBI:37533] (51)   azobenzenes [CHEBI:22682] (21)   olsalazine [CHEBI:7770] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   dicarboxylic acid [CHEBI:35692] (312)   olsalazine [CHEBI:7770] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   dicarboxylic acid [CHEBI:35692] (312)   olsalazine [CHEBI:7770] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   dicarboxylic acid [CHEBI:35692] (312)   olsalazine [CHEBI:7770] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   dicarboxylic acid [CHEBI:35692] (312)   olsalazine [CHEBI:7770] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   dicarboxylic acid [CHEBI:35692] (312)   olsalazine [CHEBI:7770] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   dicarboxylic acid [CHEBI:35692] (312)   olsalazine [CHEBI:7770] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   dicarboxylic acid [CHEBI:35692] (312)   olsalazine [CHEBI:7770] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   dicarboxylic acid [CHEBI:35692] (312)   olsalazine [CHEBI:7770] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   azobenzenes [CHEBI:22682] (21)   olsalazine [CHEBI:7770] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   azobenzenes [CHEBI:22682] (21)   olsalazine [CHEBI:7770] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   dicarboxylic acid [CHEBI:35692] (312)   olsalazine [CHEBI:7770] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   azobenzenes [CHEBI:22682] (21)   olsalazine [CHEBI:7770] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   azobenzenes [CHEBI:22682] (21)   olsalazine [CHEBI:7770] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   azobenzenes [CHEBI:22682] (21)   olsalazine [CHEBI:7770] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   azobenzenes [CHEBI:22682] (21)   olsalazine [CHEBI:7770] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   azobenzenes [CHEBI:22682] (21)   olsalazine [CHEBI:7770] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   azobenzenes [CHEBI:22682] (21)   olsalazine [CHEBI:7770] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   dicarboxylic acid [CHEBI:35692] (312)   olsalazine [CHEBI:7770] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   dicarboxylic acid [CHEBI:35692] (312)   olsalazine [CHEBI:7770] (1) ChEBI Compound Accession Identifier:   [CHEBI:7770] ChEBI Compound Description:   An azobenzene that consists of two molecules of 4-aminosalicylic acid joined by an azo linkage. A prodrug for mesalazine, an anti-inflammatory drug, it is used (as the disodium salt) in the treatment of inflammatory bowel disease. ChEBI Compound Identification Number:   7770 ChEBI InChI Value:   InChI=1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22) ChEBI InChIKey Value:   QQBDLJCYGRGAKP-UHFFFAOYSA-N ChEBI Compound Name:   olsalazine ChEBI SMILES Value:   OC(=O)c1cc(ccc1O)N=Nc1ccc(O)c(c1)C(O)=O ChEBI Substance ID:   135610178 ChEBI URL:   ChEBI:7770 ChemSpider ID:   4777171 Ontomatica Chemical Accession Key (OnChAKey):   QQBDLJCYGRGAKP_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   6003770