Item 1 of 1 (back to results) almotriptan An indole compound having a 2-(dimethylamino)ethyl group at the 3-position and a (pyrrolidin-1-ylsulfonyl)methyl group at the 5-position.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > anti-inflammatory drug [CHEBI:35472] > non-steroidal anti-inflammatory drug [CHEBI:35475] > almotriptan [CHEBI:520985] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   serotonergic drug [CHEBI:48278] (109)   serotonergic agonist [CHEBI:35941] (41)   almotriptan [CHEBI:520985] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   anti-inflammatory drug [CHEBI:35472] (112)   non-steroidal anti-inflammatory drug [CHEBI:35475] (71)   almotriptan [CHEBI:520985] (1)  cardiovascular drug [CHEBI:35554] (162)   vasoconstrictor agent [CHEBI:50514] (29)   almotriptan [CHEBI:520985] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   sulfonamide [CHEBI:35358] (106)   almotriptan [CHEBI:520985] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organic amino compound [CHEBI:50047] (2472)   amine [CHEBI:32952] (179)   tertiary amine [CHEBI:32876] (84)   almotriptan [CHEBI:520985] (1)  tertiary amino compound [CHEBI:50996] (199)   tertiary amine [CHEBI:32876] (84)   almotriptan [CHEBI:520985] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   sulfur molecular entity [CHEBI:26835] (1541)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   sulfonamide [CHEBI:35358] (106)   almotriptan [CHEBI:520985] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organic amino compound [CHEBI:50047] (2472)   amine [CHEBI:32952] (179)   tertiary amine [CHEBI:32876] (84)   almotriptan [CHEBI:520985] (1)  tertiary amino compound [CHEBI:50996] (199)   tertiary amine [CHEBI:32876] (84)   almotriptan [CHEBI:520985] (1)  organic amino compound [CHEBI:50047] (2472)   amine [CHEBI:32952] (179)   tertiary amine [CHEBI:32876] (84)   almotriptan [CHEBI:520985] (1)  tertiary amino compound [CHEBI:50996] (199)   tertiary amine [CHEBI:32876] (84)   almotriptan [CHEBI:520985] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   almotriptan [CHEBI:520985] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   oxoacid derivative [CHEBI:33241] (3254)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   sulfonamide [CHEBI:35358] (106)   almotriptan [CHEBI:520985] (1) ChEBI Compound Accession Identifier:   [CHEBI:520985] ChEBI Compound Description:   An indole compound having a 2-(dimethylamino)ethyl group at the 3-position and a (pyrrolidin-1-ylsulfonyl)methyl group at the 5-position. ChEBI Compound Identification Number:   520985 ChEBI InChI Value:   InChI=1S/C17H25N3O2S/c1-19(2)10-7-15-12-18-17-6-5-14(11-16(15)17)13-23(21,22)20-8-3-4-9-20/h5-6,11-12,18H,3-4,7-10,13H2,1-2H3 ChEBI InChIKey Value:   WKEMJKQOLOHJLZ-UHFFFAOYSA-N ChEBI Compound Name:   almotriptan ChEBI SMILES Value:   CN(C)CCc1c[nH]c2ccc(CS(=O)(=O)N3CCCC3)cc12 ChEBI Substance ID:   85709739 ChEBI URL:   ChEBI:520985 ChemSpider ID:   110198 Ontomatica Chemical Accession Key (OnChAKey):   WKEMJKQOLOHJLZ_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   123606