| more general categories |
information about this item |
|
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
|
|
|
|
|
|
triamcinolone acetonide [CHEBI:71418] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:71418] |
| ChEBI Compound Description: |
A synthetic glucocorticoid that is the 16,17-acetonide of triamcinolone. Used to treat various skin infections. |
| ChEBI Compound Identification Number: |
71418 |
| ChEBI InChI Value: |
InChI=1S/C24H31FO6/c1-20(2)30-19-10-16-15-6-5-13-9-14(27)7-8-21(13,3)23(15,25)17(28)11-22(16,4)24(19,31-20)18(29)12-26/h7-9,15-17,19,26,28H,5-6,10-12H2,1-4H3/t15-,16-,17-,19+,21-,22-,23-,24+/m0/s1 |
| ChEBI InChIKey Value: |
YNDXUCZADRHECN-JNQJZLCISA-N |
| ChEBI Compound Name: |
triamcinolone acetonide |
| ChEBI SMILES Value: |
[H][C@@]12C[C@H]3OC(C)(C)O[C@@]3(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C |
| ChEBI Substance ID: |
160655722 |
| ChEBI URL: |
ChEBI:71418 |
| ChemSpider ID: |
6196 |
| Ontomatica Chemical Accession Key (OnChAKey): |
YNDXUCZADRHECN_JNQJZLCISA_N_000_000000 |
| PubChem Compound ID: |
6436 |