Item 1 of 1 (back to results) ehretianone An organic heterotetracyclic compound that is 9,9a-dihydro-9,4a-prop[1]enoxanthene-1,4-dione substituted by a hydroxy group at position 7, a methyl group at position 12 and a prenyl group at position 9a. Isolated from the root barks of Ehretia buxifolia, it exhibits antisnake venom activity.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > protective agent [CHEBI:50267] > antidote [CHEBI:50247] > ehretianone [CHEBI:65821] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   ehretianone [CHEBI:65821] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   protective agent [CHEBI:50267] (74)   antidote [CHEBI:50247] (10)   ehretianone [CHEBI:65821] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   ehretianone [CHEBI:65821] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   ehretianone [CHEBI:65821] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   ehretianone [CHEBI:65821] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ehretianone [CHEBI:65821] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   ehretianone [CHEBI:65821] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   ehretianone [CHEBI:65821] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ehretianone [CHEBI:65821] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   ehretianone [CHEBI:65821] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   ehretianone [CHEBI:65821] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   ehretianone [CHEBI:65821] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   ehretianone [CHEBI:65821] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ehretianone [CHEBI:65821] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   ehretianone [CHEBI:65821] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   ehretianone [CHEBI:65821] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   ehretianone [CHEBI:65821] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   ehretianone [CHEBI:65821] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   ehretianone [CHEBI:65821] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ehretianone [CHEBI:65821] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   ehretianone [CHEBI:65821] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   ehretianone [CHEBI:65821] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   ehretianone [CHEBI:65821] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   ehretianone [CHEBI:65821] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   ehretianone [CHEBI:65821] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   ehretianone [CHEBI:65821] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   ehretianone [CHEBI:65821] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   ehretianone [CHEBI:65821] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   ehretianone [CHEBI:65821] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   ehretianone [CHEBI:65821] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   ehretianone [CHEBI:65821] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ehretianone [CHEBI:65821] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   ehretianone [CHEBI:65821] (1) ChEBI Compound Accession Identifier:   [CHEBI:65821] ChEBI Compound Description:   An organic heterotetracyclic compound that is 9,9a-dihydro-9,4a-prop[1]enoxanthene-1,4-dione substituted by a hydroxy group at position 7, a methyl group at position 12 and a prenyl group at position 9a. Isolated from the root barks of Ehretia buxifolia, it exhibits antisnake venom activity. ChEBI Compound Identification Number:   65821 ChEBI InChI Value:   InChI=1S/C22H22O4/c1-13(2)8-9-21-17-10-14(3)12-22(21,20(25)7-6-19(21)24)26-18-5-4-15(23)11-16(17)18/h4-8,10-11,17,23H,9,12H2,1-3H3/t17-,21-,22+/m0/s1 ChEBI InChIKey Value:   HBDVLYQTRSOPRO-BULFRSBZSA-N ChEBI Compound Name:   ehretianone ChEBI SMILES Value:   [H][C@]12C=C(C)C[C@@]3(Oc4ccc(O)cc14)C(=O)C=CC(=O)[C@]23CC=C(C)C ChEBI Substance ID:   160709589 ChEBI URL:   ChEBI:65821 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   HBDVLYQTRSOPRO_BULFRSBZSA_N_000_000000 PubChem Compound ID:   10405602