Item 1 of 1 (back to results) aloin B A C-glycosyl compound that is beta-D-glucopyranose in which the anomeric hydroxy group is replaced by a 4,5-dihydroxy-2-(hydroxymethyl)-10-oxo-9,10-dihydroanthracen-9-yl moiety (the 9R diastereoisomer).

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > laxative [CHEBI:50503] > aloin B [CHEBI:74131] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   aloin B [CHEBI:74131] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   laxative [CHEBI:50503] (9)   aloin B [CHEBI:74131] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   aloin B [CHEBI:74131] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   aloin B [CHEBI:74131] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   aloin B [CHEBI:74131] (1)  glycosyl compound [CHEBI:63161] (1006)   C-glycosyl compound [CHEBI:20857] (52)   aloin B [CHEBI:74131] (1)  carbohydrate derivative [CHEBI:63299] (2582)   C-glycosyl compound [CHEBI:20857] (52)   aloin B [CHEBI:74131] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   aloin B [CHEBI:74131] (1)  glycosyl compound [CHEBI:63161] (1006)   C-glycosyl compound [CHEBI:20857] (52)   aloin B [CHEBI:74131] (1)  carbohydrate derivative [CHEBI:63299] (2582)   C-glycosyl compound [CHEBI:20857] (52)   aloin B [CHEBI:74131] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   aloin B [CHEBI:74131] (1)  glycosyl compound [CHEBI:63161] (1006)   C-glycosyl compound [CHEBI:20857] (52)   aloin B [CHEBI:74131] (1)  carbohydrate derivative [CHEBI:63299] (2582)   C-glycosyl compound [CHEBI:20857] (52)   aloin B [CHEBI:74131] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   aloin B [CHEBI:74131] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  phenols [CHEBI:33853] (868)   aloin B [CHEBI:74131] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   aloin B [CHEBI:74131] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  phenols [CHEBI:33853] (868)   aloin B [CHEBI:74131] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  phenols [CHEBI:33853] (868)   aloin B [CHEBI:74131] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  phenols [CHEBI:33853] (868)   aloin B [CHEBI:74131] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   aloin B [CHEBI:74131] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   aloin B [CHEBI:74131] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   aloin B [CHEBI:74131] (1) ChEBI Compound Accession Identifier:   [CHEBI:74131] ChEBI Compound Description:   A C-glycosyl compound that is beta-D-glucopyranose in which the anomeric hydroxy group is replaced by a 4,5-dihydroxy-2-(hydroxymethyl)-10-oxo-9,10-dihydroanthracen-9-yl moiety (the 9R diastereoisomer). ChEBI Compound Identification Number:   74131 ChEBI InChI Value:   InChI=1S/C21H22O9/c22-6-8-4-10-14(21-20(29)19(28)17(26)13(7-23)30-21)9-2-1-3-11(24)15(9)18(27)16(10)12(25)5-8/h1-5,13-14,17,19-26,28-29H,6-7H2/t13-,14-,17-,19+,20-,21+/m1/s1 ChEBI InChIKey Value:   AFHJQYHRLPMKHU-WEZNYRQKSA-N ChEBI Compound Name:   aloin B ChEBI SMILES Value:   [H][C@]1(O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@]1([H])c2cccc(O)c2C(=O)c2c(O)cc(CO)cc12 ChEBI Substance ID:   163626927 ChEBI URL:   ChEBI:74131 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   AFHJQYHRLPMKHU_WEZNYRQKSA_N_000_000000 PubChem Compound ID:   14989