| more general categories |
information about this item |
|
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
|
|
|
clomiphene citrate [CHEBI:3753] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
clomiphene citrate [CHEBI:3753] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:3753] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
3753 |
| ChEBI InChI Value: |
"InChI=1S/C26H28ClNO.C6H8O7/c1-3-28(4-2)19-20-29-24-17-15-22(16-18-24)25(21-11-7-5-8-12-21)26(27)23-13-9-6-10-14-23;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-18H,3-4,19-20H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)" |
| ChEBI InChIKey Value: |
PYTMYKVIJXPNBD-UHFFFAOYSA-N |
| ChEBI Compound Name: |
clomiphene citrate |
| ChEBI SMILES Value: |
[H+].[H+].[H+].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O.CCN(CC)CCOc1ccc(cc1)C(c1ccccc1)=C(Cl)c1ccccc1 |
| ChEBI Substance ID: |
56352936 |
| ChEBI URL: |
ChEBI:3753 |
| ChemSpider ID: |
4925597 |
| Ontomatica Chemical Accession Key (OnChAKey): |
PYTMYKVIJXPNBD_UHFFFAOYSA_N_000_000000 |
| PubChem Compound ID: |
25010740 |