Item 1 of 1 (back to results) chlorzoxazone 3H-1,3-Benzoxazol-2-one in which the hydrogen atom at position 5 is substituted by chlorine. A centrally acting muscle relaxant with sedative properties, it is used for the symptomatic treatment of painful muscle spasm.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > neuromuscular agent [CHEBI:51372] > muscle relaxant [CHEBI:51371] > chlorzoxazone [CHEBI:3655] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   central nervous system drug [CHEBI:35470] (217)   central nervous system depressant [CHEBI:35488] (90)   sedative [CHEBI:35717] (43)   chlorzoxazone [CHEBI:3655] (1)  neuromuscular agent [CHEBI:51372] (51)   muscle relaxant [CHEBI:51371] (47)   chlorzoxazone [CHEBI:3655] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   chlorzoxazone [CHEBI:3655] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   chlorzoxazone [CHEBI:3655] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   chlorzoxazone [CHEBI:3655] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazole [CHEBI:46700] (21)   1,3-benzoxazoles [CHEBI:51548] (15)   chlorzoxazone [CHEBI:3655] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   chlorzoxazone [CHEBI:3655] (1) ChEBI Compound Accession Identifier:   [CHEBI:3655] ChEBI Compound Description:   3H-1,3-Benzoxazol-2-one in which the hydrogen atom at position 5 is substituted by chlorine. A centrally acting muscle relaxant with sedative properties, it is used for the symptomatic treatment of painful muscle spasm. ChEBI Compound Identification Number:   3655 ChEBI InChI Value:   InChI=1S/C7H4ClNO2/c8-4-1-2-6-5(3-4)9-7(10)11-6/h1-3H,(H,9,10) ChEBI InChIKey Value:   TZFWDZFKRBELIQ-UHFFFAOYSA-N ChEBI Compound Name:   chlorzoxazone ChEBI SMILES Value:   Oc1nc2cc(Cl)ccc2o1 ChEBI Substance ID:   99313626 ChEBI URL:   ChEBI:3655 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   TZFWDZFKRBELIQ_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   2733