Item 1 of 1 (back to results) ethoxzolamide 1,3-Benzothiazole substituted a sulfonamide and an ethoxy group at positions 2 and 6, respectively. A carbonic anhydrase inhibitor, it has been used in the treatment of glaucoma, and as a diuretic.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > ophthalmology drug [CHEBI:66981] > antiglaucoma drug [CHEBI:39456] > ethoxzolamide [CHEBI:101096] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   carbonic anhydrase inhibitor [CHEBI:23018] (9)   ethoxzolamide [CHEBI:101096] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   ophthalmology drug [CHEBI:66981] (30)   antiglaucoma drug [CHEBI:39456] (28)   ethoxzolamide [CHEBI:101096] (1)  diuretic [CHEBI:35498] (18)   ethoxzolamide [CHEBI:101096] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   sulfonamide [CHEBI:35358] (106)   ethoxzolamide [CHEBI:101096] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   sulfur molecular entity [CHEBI:26835] (1541)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   sulfonamide [CHEBI:35358] (106)   ethoxzolamide [CHEBI:101096] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiazoles [CHEBI:37947] (18)   ethoxzolamide [CHEBI:101096] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   oxoacid derivative [CHEBI:33241] (3254)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   sulfonamide [CHEBI:35358] (106)   ethoxzolamide [CHEBI:101096] (1) ChEBI Compound Accession Identifier:   [CHEBI:101096] ChEBI Compound Description:   1,3-Benzothiazole substituted a sulfonamide and an ethoxy group at positions 2 and 6, respectively. A carbonic anhydrase inhibitor, it has been used in the treatment of glaucoma, and as a diuretic. ChEBI Compound Identification Number:   101096 ChEBI InChI Value:   InChI=1S/C9H10N2O3S2/c1-2-14-6-3-4-7-8(5-6)15-9(11-7)16(10,12)13/h3-5H,2H2,1H3,(H2,10,12,13) ChEBI InChIKey Value:   OUZWUKMCLIBBOG-UHFFFAOYSA-N ChEBI Compound Name:   ethoxzolamide ChEBI SMILES Value:   CCOc1ccc2nc(sc2c1)S(N)(=O)=O ChEBI Substance ID:   85306595 ChEBI URL:   ChEBI:101096 ChemSpider ID:   3179 Ontomatica Chemical Accession Key (OnChAKey):   OUZWUKMCLIBBOG_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   3295