Item 1 of 1 (back to results) U50488 A carboxamide obtained by formal condensation between the carboxy group of 3,4-dichlorophenylacetic acid and the secondary amino group of (1R,2R)-N-methyl-2-(pyrrolidin-1-yl)cyclohexanamine

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > diuretic [CHEBI:35498] > U50488 [CHEBI:73358] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biophysical uses [CHEBI:52208] (136)   membrane transport modulator [CHEBI:38632] (122)   calcium channel modulator [CHEBI:38808] (32)   calcium channel blocker [CHEBI:38215] (24)   U50488 [CHEBI:73358] (1)  pharmacological uses [CHEBI:52210] (736)   analgesic [CHEBI:35480] (114)   U50488 [CHEBI:73358] (1)  neurotransmitter agent [CHEBI:35942] (471)   opioid agent [CHEBI:60598] (32)   kappa-opioid agent [CHEBI:60603] (6)   kappa-opioid receptor agonist [CHEBI:59282] (6)   U50488 [CHEBI:73358] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antitussive [CHEBI:51177] (13)   U50488 [CHEBI:73358] (1)  diuretic [CHEBI:35498] (18)   U50488 [CHEBI:73358] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   U50488 [CHEBI:73358] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   U50488 [CHEBI:73358] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   U50488 [CHEBI:73358] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   U50488 [CHEBI:73358] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U50488 [CHEBI:73358] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   U50488 [CHEBI:73358] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   U50488 [CHEBI:73358] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U50488 [CHEBI:73358] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U50488 [CHEBI:73358] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   U50488 [CHEBI:73358] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U50488 [CHEBI:73358] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   U50488 [CHEBI:73358] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   U50488 [CHEBI:73358] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U50488 [CHEBI:73358] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U50488 [CHEBI:73358] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U50488 [CHEBI:73358] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U50488 [CHEBI:73358] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U50488 [CHEBI:73358] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U50488 [CHEBI:73358] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U50488 [CHEBI:73358] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U50488 [CHEBI:73358] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U50488 [CHEBI:73358] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U50488 [CHEBI:73358] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   U50488 [CHEBI:73358] (1) ChEBI Compound Accession Identifier:   [CHEBI:73358] ChEBI Compound Description:   A carboxamide obtained by formal condensation between the carboxy group of 3,4-dichlorophenylacetic acid and the secondary amino group of (1R,2R)-N-methyl-2-(pyrrolidin-1-yl)cyclohexanamine ChEBI Compound Identification Number:   73358 ChEBI InChI Value:   InChI=1S/C19H26Cl2N2O/c1-22(19(24)13-14-8-9-15(20)16(21)12-14)17-6-2-3-7-18(17)23-10-4-5-11-23/h8-9,12,17-18H,2-7,10-11,13H2,1H3/t17-,18-/m1/s1 ChEBI InChIKey Value:   VQLPLYSROCPWFF-QZTJIDSGSA-N ChEBI Compound Name:   U50488 ChEBI SMILES Value:   CN([C@@H]1CCCC[C@H]1N1CCCC1)C(=O)Cc1ccc(Cl)c(Cl)c1 ChEBI Substance ID:   163425981 ChEBI URL:   ChEBI:73358 ChemSpider ID:   2300345 Ontomatica Chemical Accession Key (OnChAKey):   VQLPLYSROCPWFF_QZTJIDSGSA_N_000_000000 PubChem Compound ID:   3036289