| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
arformoterol fumarate [CHEBI:63108] (1) |
|
 |
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
|
|
|
arformoterol fumarate [CHEBI:63108] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
arformoterol fumarate [CHEBI:63108] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:63108] |
| ChEBI Compound Description: |
A fumarate salt prepared from arformoterol by reaction of one molecule of fumaric acid for every two molecules of arformoterol. |
| ChEBI Compound Identification Number: |
63108 |
| ChEBI InChI Value: |
"InChI=1S/2C19H24N2O4.C4H4O4/c2*1-13(9-14-3-6-16(25-2)7-4-14)20-11-19(24)15-5-8-18(23)17(10-15)21-12-22;5-3(6)1-2-4(7)8/h2*3-8,10,12-13,19-20,23-24H,9,11H2,1-2H3,(H,21,22);1-2H,(H,5,6)(H,7,8)/b;;2-1+/t2*13-,19+;/m11./s1" |
| ChEBI InChIKey Value: |
OBRNDARFFFHCGE-QDSVTUBZSA-N |
| ChEBI Compound Name: |
arformoterol fumarate |
| ChEBI SMILES Value: |
OC(=O)\C=C\C(O)=O.[H]C(=O)Nc1cc(ccc1O)[C@@H](O)CN[C@H](C)Cc1ccc(OC)cc1.[H]C(=O)Nc1cc(ccc1O)[C@@H](O)CN[C@H](C)Cc1ccc(OC)cc1 |
| ChEBI Substance ID: |
126522701 |
| ChEBI URL: |
ChEBI:63108 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
OBRNDARFFFHCGE_QDSVTUBZSA_N_000_000000 |
| PubChem Compound ID: |
53477580 |