Item 1 of 1 (back to results) clenbuterol Clenbuterol is a primary arylamine that is 2,6-dichloroaniline in which the hydrogen at position 4 is substituted by a 2-(tert-butylamino)-1-hydroxyethyl group.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > bronchodilator agent [CHEBI:35523] > clenbuterol [CHEBI:174690] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   adrenergic agent [CHEBI:37962] (143)   sympathomimetic agent [CHEBI:35524] (33)   clenbuterol [CHEBI:174690] (1)  adrenergic agonist [CHEBI:37886] (42)   beta-adrenergic agonist [CHEBI:35522] (24)   clenbuterol [CHEBI:174690] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   bronchodilator agent [CHEBI:35523] (34)   clenbuterol [CHEBI:174690] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   amino alcohol [CHEBI:22478] (250)   clenbuterol [CHEBI:174690] (3)  ethanolamines [CHEBI:23981] (167)   clenbuterol [CHEBI:174690] (3)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   clenbuterol [CHEBI:174690] (3)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   clenbuterol [CHEBI:174690] (3)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   amino alcohol [CHEBI:22478] (250)   clenbuterol [CHEBI:174690] (3)  ethanolamines [CHEBI:23981] (167)   clenbuterol [CHEBI:174690] (3)  amine [CHEBI:32952] (179)   primary amine [CHEBI:32877] (40)   primary arylamine [CHEBI:50471] (18)   clenbuterol [CHEBI:174690] (3)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  primary amino compound [CHEBI:50994] (104)   primary amine [CHEBI:32877] (40)   primary arylamine [CHEBI:50471] (18)   clenbuterol [CHEBI:174690] (3)  secondary amino compound [CHEBI:50995] (110)   clenbuterol [CHEBI:174690] (3)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   amino alcohol [CHEBI:22478] (250)   clenbuterol [CHEBI:174690] (3)  ethanolamines [CHEBI:23981] (167)   clenbuterol [CHEBI:174690] (3)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   amino alcohol [CHEBI:22478] (250)   clenbuterol [CHEBI:174690] (3)  ethanolamines [CHEBI:23981] (167)   clenbuterol [CHEBI:174690] (3)  amine [CHEBI:32952] (179)   primary amine [CHEBI:32877] (40)   primary arylamine [CHEBI:50471] (18)   clenbuterol [CHEBI:174690] (3)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  primary amino compound [CHEBI:50994] (104)   primary amine [CHEBI:32877] (40)   primary arylamine [CHEBI:50471] (18)   clenbuterol [CHEBI:174690] (3)  secondary amino compound [CHEBI:50995] (110)   clenbuterol [CHEBI:174690] (3)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   clenbuterol [CHEBI:174690] (3)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   amino alcohol [CHEBI:22478] (250)   clenbuterol [CHEBI:174690] (3)  ethanolamines [CHEBI:23981] (167)   clenbuterol [CHEBI:174690] (3)  organic amino compound [CHEBI:50047] (2472)   amino alcohol [CHEBI:22478] (250)   clenbuterol [CHEBI:174690] (3)  ethanolamines [CHEBI:23981] (167)   clenbuterol [CHEBI:174690] (3)  amine [CHEBI:32952] (179)   primary amine [CHEBI:32877] (40)   primary arylamine [CHEBI:50471] (18)   clenbuterol [CHEBI:174690] (3)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  primary amino compound [CHEBI:50994] (104)   primary amine [CHEBI:32877] (40)   primary arylamine [CHEBI:50471] (18)   clenbuterol [CHEBI:174690] (3)  secondary amino compound [CHEBI:50995] (110)   clenbuterol [CHEBI:174690] (3)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   clenbuterol [CHEBI:174690] (3)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   amino alcohol [CHEBI:22478] (250)   clenbuterol [CHEBI:174690] (3)  ethanolamines [CHEBI:23981] (167)   clenbuterol [CHEBI:174690] (3)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   clenbuterol [CHEBI:174690] (3) ChEBI Compound Accession Identifier:   [CHEBI:174690] ChEBI Compound Description:   Clenbuterol is a primary arylamine that is 2,6-dichloroaniline in which the hydrogen at position 4 is substituted by a 2-(tert-butylamino)-1-hydroxyethyl group. ChEBI Compound Identification Number:   174690 ChEBI InChI Value:   InChI=1S/C12H18Cl2N2O/c1-12(2,3)16-6-10(17)7-4-8(13)11(15)9(14)5-7/h4-5,10,16-17H,6,15H2,1-3H3 ChEBI InChIKey Value:   STJMRWALKKWQGH-UHFFFAOYSA-N ChEBI Compound Name:   clenbuterol ChEBI SMILES Value:   CC(C)(C)NCC(O)c1cc(Cl)c(N)c(Cl)c1 ChEBI Substance ID:   85373776 ChEBI URL:   ChEBI:174690 ChemSpider ID:   2681 Ontomatica Chemical Accession Key (OnChAKey):   STJMRWALKKWQGH_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   2783