Item 1 of 1 (back to results) graminone B A lignan that is tetrahydro-1H,3H-furo[3,4-c]furan-1-one substituted by a 3-hydroxy-4,5-dimethoxyphenyl at position 3 and a 3-hydroxy-4,5-dimethoxyphenyl group at position 5. Isolated from the rhizomes of Imperata cylindrica, it exhibits vasodilative activity.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > cardiovascular drug [CHEBI:35554] > vasodilator agent [CHEBI:35620] > graminone B [CHEBI:65979] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   graminone B [CHEBI:65979] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   cardiovascular drug [CHEBI:35554] (162)   vasodilator agent [CHEBI:35620] (65)   graminone B [CHEBI:65979] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Liliopsida (183)   Poales (46)   Poaceae (42)   Imperata (2)   Imperata cylindrica (2) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  plant structure [PO:0009011] (1497)   multi-tissue plant structure [PO:0025496] (1114)   plant organ [PO:0009008] (970)   plant axis [PO:0025004] (691)   shoot axis [PO:0025029] (271)   rhizome [PO:0004542] (88) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   graminone B [CHEBI:65979] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   graminone B [CHEBI:65979] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   graminone B [CHEBI:65979] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   graminone B [CHEBI:65979] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   graminone B [CHEBI:65979] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   graminone B [CHEBI:65979] (1)  ester [CHEBI:35701] (3370)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   graminone B [CHEBI:65979] (1)  phenols [CHEBI:33853] (868)   graminone B [CHEBI:65979] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   graminone B [CHEBI:65979] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   graminone B [CHEBI:65979] (1)  phenols [CHEBI:33853] (868)   graminone B [CHEBI:65979] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   graminone B [CHEBI:65979] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   graminone B [CHEBI:65979] (1)  phenols [CHEBI:33853] (868)   graminone B [CHEBI:65979] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   graminone B [CHEBI:65979] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenylpropanoid [CHEBI:26004] (374)   lignan [CHEBI:25036] (34)   graminone B [CHEBI:65979] (1)  phenols [CHEBI:33853] (868)   graminone B [CHEBI:65979] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   graminone B [CHEBI:65979] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   graminone B [CHEBI:65979] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   graminone B [CHEBI:65979] (1) ChEBI Compound Accession Identifier:   [CHEBI:65979] ChEBI Compound Description:   A lignan that is tetrahydro-1H,3H-furo[3,4-c]furan-1-one substituted by a 3-hydroxy-4,5-dimethoxyphenyl at position 3 and a 3-hydroxy-4,5-dimethoxyphenyl group at position 5. Isolated from the rhizomes of Imperata cylindrica, it exhibits vasodilative activity. ChEBI Compound Identification Number:   65979 ChEBI InChI Value:   InChI=1S/C21H22O8/c1-25-13-5-10(4-12(22)8-13)19-17-14(9-28-19)18(29-21(17)24)11-6-15(23)20(27-3)16(7-11)26-2/h4-8,14,17-19,22-23H,9H2,1-3H3/t14-,17-,18+,19+/m1/s1 ChEBI InChIKey Value:   JTDVCRMQMDJLOR-OAOYMFHYSA-N ChEBI Compound Name:   graminone B ChEBI SMILES Value:   [H][C@@]12CO[C@@H](c3cc(O)cc(OC)c3)[C@]1([H])C(=O)O[C@H]2c1cc(O)c(OC)c(OC)c1 ChEBI Substance ID:   160709646 ChEBI URL:   ChEBI:65979 ChemSpider ID:   8176731 Ontomatica Chemical Accession Key (OnChAKey):   JTDVCRMQMDJLOR_OAOYMFHYSA_N_000_000000 PubChem Compound ID:   10001150