Item 1 of 1 (back to results) caulophine A member of the class of fluoren-9-ones that is 9H-fluoren-9-one substituted by 2-(dimethylamino)ethyl group at position 3, hydroxy groups at positions 4 and 5 and two methoxy groups at positions 1 and 6 respectively. It is isolated from the radix of Caulophyllum robustum and exhibits anti-myocardial ischemia activity.

Current search: 05. Industrial Uses: pharmaceutical [CHEBI:52217] > drug [CHEBI:23888] > cardiovascular drug [CHEBI:35554] > caulophine [CHEBI:65604] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   caulophine [CHEBI:65604] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   cardiovascular drug [CHEBI:35554] (162)   caulophine [CHEBI:65604] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   caulophine [CHEBI:65604] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   caulophine [CHEBI:65604] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   caulophine [CHEBI:65604] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   caulophine [CHEBI:65604] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   caulophine [CHEBI:65604] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   caulophine [CHEBI:65604] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   caulophine [CHEBI:65604] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   caulophine [CHEBI:65604] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   caulophine [CHEBI:65604] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   caulophine [CHEBI:65604] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   caulophine [CHEBI:65604] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   fluorenes [CHEBI:24059] (8)   fluoren-9-ones [CHEBI:24057] (2)   caulophine [CHEBI:65604] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   caulophine [CHEBI:65604] (1)  aromatic ether [CHEBI:35618] (353)   caulophine [CHEBI:65604] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   fluorenes [CHEBI:24059] (8)   fluoren-9-ones [CHEBI:24057] (2)   caulophine [CHEBI:65604] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   fluorenes [CHEBI:24059] (8)   fluoren-9-ones [CHEBI:24057] (2)   caulophine [CHEBI:65604] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   fluorenes [CHEBI:24059] (8)   fluoren-9-ones [CHEBI:24057] (2)   caulophine [CHEBI:65604] (1)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   fluorenes [CHEBI:24059] (8)   fluoren-9-ones [CHEBI:24057] (2)   caulophine [CHEBI:65604] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   fluorenes [CHEBI:24059] (8)   fluoren-9-ones [CHEBI:24057] (2)   caulophine [CHEBI:65604] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   caulophine [CHEBI:65604] (1)  aromatic ether [CHEBI:35618] (353)   caulophine [CHEBI:65604] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   fluorenes [CHEBI:24059] (8)   fluoren-9-ones [CHEBI:24057] (2)   caulophine [CHEBI:65604] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   caulophine [CHEBI:65604] (1)  aromatic ether [CHEBI:35618] (353)   caulophine [CHEBI:65604] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   fluorenes [CHEBI:24059] (8)   fluoren-9-ones [CHEBI:24057] (2)   caulophine [CHEBI:65604] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   fluorenes [CHEBI:24059] (8)   fluoren-9-ones [CHEBI:24057] (2)   caulophine [CHEBI:65604] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   caulophine [CHEBI:65604] (1)  aromatic ether [CHEBI:35618] (353)   caulophine [CHEBI:65604] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   fluorenes [CHEBI:24059] (8)   fluoren-9-ones [CHEBI:24057] (2)   caulophine [CHEBI:65604] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   caulophine [CHEBI:65604] (1) ChEBI Compound Accession Identifier:   [CHEBI:65604] ChEBI Compound Description:   A member of the class of fluoren-9-ones that is 9H-fluoren-9-one substituted by 2-(dimethylamino)ethyl group at position 3, hydroxy groups at positions 4 and 5 and two methoxy groups at positions 1 and 6 respectively. It is isolated from the radix of Caulophyllum robustum and exhibits anti-myocardial ischemia activity. ChEBI Compound Identification Number:   65604 ChEBI InChI Value:   InChI=1S/C19H21NO5/c1-20(2)8-7-10-9-13(25-4)15-16(17(10)21)14-11(18(15)22)5-6-12(24-3)19(14)23/h5-6,9,21,23H,7-8H2,1-4H3 ChEBI InChIKey Value:   NDCDKMMCPZJBEB-UHFFFAOYSA-N ChEBI Compound Name:   caulophine ChEBI SMILES Value:   COc1ccc2C(=O)c3c(OC)cc(CCN(C)C)c(O)c3-c2c1O ChEBI Substance ID:   160655776 ChEBI URL:   ChEBI:65604 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   NDCDKMMCPZJBEB_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   70680258