New Search

Item 1 of 1 (back to results)

disopyramide
null


Current search:

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 cardiovascular drug [CHEBI:35554] (162) 
 anti-arrhythmia drug [CHEBI:38070] (56) 
 disopyramide [CHEBI:4657] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 disopyramide [CHEBI:4657] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 disopyramide [CHEBI:4657] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 disopyramide [CHEBI:4657] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 disopyramide [CHEBI:4657] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 disopyramide [CHEBI:4657] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 disopyramide [CHEBI:4657] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 disopyramide [CHEBI:4657] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 disopyramide [CHEBI:4657] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 disopyramide [CHEBI:4657] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 disopyramide [CHEBI:4657] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 disopyramide [CHEBI:4657] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 disopyramide [CHEBI:4657] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 disopyramide [CHEBI:4657] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 disopyramide [CHEBI:4657] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 disopyramide [CHEBI:4657] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 disopyramide [CHEBI:4657] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 disopyramide [CHEBI:4657] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 disopyramide [CHEBI:4657] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 disopyramide [CHEBI:4657] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 disopyramide [CHEBI:4657] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 disopyramide [CHEBI:4657] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 disopyramide [CHEBI:4657] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 disopyramide [CHEBI:4657] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 disopyramide [CHEBI:4657] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 disopyramide [CHEBI:4657] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 disopyramide [CHEBI:4657] (1)
ChEBI Compound Accession Identifier  [CHEBI:4657]
ChEBI Compound Description  null
ChEBI Compound Identification Number  4657
ChEBI InChI Value  InChI=1S/C21H29N3O/c1-16(2)24(17(3)4)15-13-21(20(22)25,18-10-6-5-7-11-18)19-12-8-9-14-23-19/h5-12,14,16-17H,13,15H2,1-4H3,(H2,22,25)
ChEBI InChIKey Value  UVTNFZQICZKOEM-UHFFFAOYSA-N
ChEBI Compound Name  disopyramide
ChEBI SMILES Value  CC(C)N(CCC(C(N)=O)(c1ccccc1)c1ccccn1)C(C)C
ChEBI Substance ID  56394974
ChEBI URL  ChEBI:4657
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  UVTNFZQICZKOEM_UHFFFAOYSA_N_000_000000
PubChem Compound ID  3114