| more general categories |
information about this item |
|
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
gadopentetate [CHEBI:35778] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
gadopentetate [CHEBI:35778] (1) |
|
|
|
|
|
|
|
gadopentetate [CHEBI:35778] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:35778] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
35778 |
| ChEBI InChI Value: |
"InChI=1S/C14H23N3O10.Gd/c18-10(19)5-15(1-3-16(6-11(20)21)7-12(22)23)2-4-17(8-13(24)25)9-14(26)27;/h1-9H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27);/q;+3/p-3" |
| ChEBI InChIKey Value: |
IZOOGPBRAOKZFK-UHFFFAOYSA-K |
| ChEBI Compound Name: |
gadopentetate |
| ChEBI SMILES Value: |
[Gd+3].OC(=O)CN(CCN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O)CC([O-])=O |
| ChEBI Substance ID: |
11533522 |
| ChEBI URL: |
ChEBI:35778 |
| ChemSpider ID: |
138549 |
| Ontomatica Chemical Accession Key (OnChAKey): |
IZOOGPBRAOKZFK_UHFFFAOYSA_K_000_000000 |
| PubChem Compound ID: |
6857474 |