New Search

Item 1 of 1 (back to results)

corticotropin-releasing hormone (ovine)
A corticotropin-releasing hormone from sheep composed of Ser, Gln, Glu, Pro, Pro, Ile, Ser, Leu, Asp, Leu, Val, Phe, His, Leu, Leu, Arg, Glu, Val, Leu, Glu, Met, Thr, Lys, Ala, Asp, Gln, Leu, Ala, Gln, Gln, Ala, His, Ser, Asn, Arg, Lys, Leu, Leu, Asp, Ile and Ala-NH2 residues joined in sequence.


Current search:

05. Industrial Uses: pharmaceutical [CHEBI:52217] > diagnostic agent [CHEBI:33295] > corticotropin-releasing hormone (ovine) [CHEBI:65307]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 diagnostic agent [CHEBI:33295] (53) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 polypeptide [CHEBI:15841] (46) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 peptide hormone [CHEBI:25905] (16) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 polypeptide [CHEBI:15841] (46) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 peptide hormone [CHEBI:25905] (16) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 polypeptide [CHEBI:15841] (46) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 peptide hormone [CHEBI:25905] (16) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 polypeptide [CHEBI:15841] (46) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 peptide hormone [CHEBI:25905] (16) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 polypeptide [CHEBI:15841] (46) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 peptide hormone [CHEBI:25905] (16) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 polypeptide [CHEBI:15841] (46) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 peptide hormone [CHEBI:25905] (16) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 polypeptide [CHEBI:15841] (46) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 peptide hormone [CHEBI:25905] (16) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 polypeptide [CHEBI:15841] (46) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 peptide hormone [CHEBI:25905] (16) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 biomacromolecule [CHEBI:33694] (43) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 polypeptide [CHEBI:15841] (46) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 peptide hormone [CHEBI:25905] (16) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 macromolecule [CHEBI:33839] (103) 
 polypeptide [CHEBI:15841] (46) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
 biomacromolecule [CHEBI:33694] (43) 
 corticotropin-releasing hormone [CHEBI:65311] (2) 
 corticotropin-releasing hormone (ovine) [CHEBI:65307] (1)
ChEBI Compound Accession Identifier  [CHEBI:65307]
ChEBI Compound Description  A corticotropin-releasing hormone from sheep composed of Ser, Gln, Glu, Pro, Pro, Ile, Ser, Leu, Asp, Leu, Val, Phe, His, Leu, Leu, Arg, Glu, Val, Leu, Glu, Met, Thr, Lys, Ala, Asp, Gln, Leu, Ala, Gln, Gln, Ala, His, Ser, Asn, Arg, Lys, Leu, Leu, Asp, Ile and Ala-NH2 residues joined in sequence.
ChEBI Compound Identification Number  65307
ChEBI InChI Value  InChI=1S/C206H341N59O62S/c1-31-106(23)161(200(323)226-108(25)164(215)287)261-194(317)143(88-158(285)286)254-185(308)133(78-100(11)12)247-183(306)131(76-98(7)8)245-173(296)118(47-37-39-68-208)232-171(294)119(48-40-69-222-205(216)217)234-190(313)140(85-152(214)274)252-195(318)144(92-267)257-189(312)138(83-114-89-220-94-224-114)242-166(289)110(27)228-170(293)121(52-59-148(210)270)235-174(297)122(53-60-149(211)271)230-165(288)109(26)229-180(303)129(74-96(3)4)244-177(300)124(55-62-151(213)273)237-191(314)141(86-156(281)282)243-167(290)111(28)227-169(292)117(46-36-38-67-207)240-202(325)163(112(29)269)263-179(302)127(66-73-328-30)239-175(298)125(56-63-153(275)276)238-182(305)135(80-102(15)16)255-198(321)159(104(19)20)259-178(301)126(57-64-154(277)278)236-172(295)120(49-41-70-223-206(218)219)233-181(304)130(75-97(5)6)246-184(307)132(77-99(9)10)248-188(311)139(84-115-90-221-95-225-115)251-187(310)137(82-113-44-34-33-35-45-113)256-199(322)160(105(21)22)260-193(316)136(81-103(17)18)249-192(315)142(87-157(283)284)253-186(309)134(79-101(13)14)250-196(319)145(93-268)258-201(324)162(107(24)32-2)262-197(320)146-50-42-71-264(146)204(327)147-51-43-72-265(147)203(326)128(58-65-155(279)280)241-176(299)123(54-61-150(212)272)231-168(291)116(209)91-266/h33-35,44-45,89-90,94-112,116-147,159-163,266-269H,31-32,36-43,46-88,91-93,207-209H2,1-30H3,(H2,210,270)(H2,211,271)(H2,212,272)(H2,213,273)(H2,214,274)(H2,215,287)(H,220,224)(H,221,225)(H,226,323)(H,227,292)(H,228,293)(H,229,303)(H,230,288)(H,231,291)(H,232,294)(H,233,304)(H,234,313)(H,235,297)(H,236,295)(H,237,314)(H,238,305)(H,239,298)(H,240,325)(H,241,299)(H,242,289)(H,243,290)(H,244,300)(H,245,296)(H,246,307)(H,247,306)(H,248,311)(H,249,315)(H,250,319)(H,251,310)(H,252,318)(H,253,309)(H,254,308)(H,255,321)(H,256,322)(H,257,312)(H,258,324)(H,259,301)(H,260,316)(H,261,317)(H,262,320)(H,263,302)(H,275,276)(H,277,278)(H,279,280)(H,281,282)(H,283,284)(H,285,286)(H4,216,217,222)(H4,218,219,223)/t106-,107-,108-,109-,110-,111-,112+,116-,117-,118-,119-,120-,121-,122-,123-,124-,125-,126-,127-,128-,129-,130-,131-,132-,133-,134-,135-,136-,137-,138-,139-,140-,141-,142-,143-,144-,145-,146-,147-,159-,160-,161-,162-,163-/m0/s1
ChEBI InChIKey Value  QMZRMXQCHRPRQD-SAWSQHHPSA-N
ChEBI Compound Name  corticotropin-releasing hormone (ovine)
ChEBI SMILES Value  CC[C@H](C)[C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](CCSC)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CO)[C@@H](C)CC)C(C)C)C(C)C)[C@@H](C)O)C(=O)N[C@@H](C)C(N)=O
ChEBI Substance ID  160645002
ChEBI URL  ChEBI:65307
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  QMZRMXQCHRPRQD_SAWSQHHPSA_N_000_000000
PubChem Compound ID  70678690