New Search

Item 1 of 10 (back to results)
next Next

chlordiazepoxide
null


Current search:

05. Industrial Uses: pharmaceutical [CHEBI:52217] > adjuvant [CHEBI:60809] > anaesthesia adjuvant [CHEBI:60807]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 central nervous system drug [CHEBI:35470] (217) 
 psychotropic drug [CHEBI:35471] (130) 
 tranquilizing drug [CHEBI:35473] (83) 
 anxiolytic drug [CHEBI:35474] (31) 
 chlordiazepoxide [CHEBI:3611] (1)
 central nervous system depressant [CHEBI:35488] (90) 
 sedative [CHEBI:35717] (43) 
 chlordiazepoxide [CHEBI:3611] (1)
 adjuvant [CHEBI:60809] (12) 
 anaesthesia adjuvant [CHEBI:60807] (10) 
 chlordiazepoxide [CHEBI:3611] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 chlorine molecular entity [CHEBI:23117] (884) 
 organochlorine compound [CHEBI:36683] (543) 
 chlordiazepoxide [CHEBI:3611] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 chlordiazepoxide [CHEBI:3611] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 oxide [CHEBI:25741] (2086) 
 N-oxide [CHEBI:35580] (23) 
 chlordiazepoxide [CHEBI:3611] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 chlordiazepoxide [CHEBI:3611] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzodiazepine [CHEBI:22720] (17) 
 chlordiazepoxide [CHEBI:3611] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 oxide [CHEBI:25741] (2086) 
 N-oxide [CHEBI:35580] (23) 
 chlordiazepoxide [CHEBI:3611] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 chlordiazepoxide [CHEBI:3611] (1)
ChEBI Compound Accession Identifier  [CHEBI:3611]
ChEBI Compound Description  null
ChEBI Compound Identification Number  3611
ChEBI InChI Value  InChI=1S/C16H14ClN3O/c1-18-15-10-20(21)16(11-5-3-2-4-6-11)13-9-12(17)7-8-14(13)19-15/h2-9H,10H2,1H3,(H,18,19)
ChEBI InChIKey Value  ANTSCNMPPGJYLG-UHFFFAOYSA-N
ChEBI Compound Name  chlordiazepoxide
ChEBI SMILES Value  CNC1=Nc2ccc(Cl)cc2C(c2ccccc2)=N(=O)C1
ChEBI Substance ID  0
ChEBI URL  ChEBI:3611
ChemSpider ID  10248513
Ontomatica Chemical Accession Key (OnChAKey)  ANTSCNMPPGJYLG_UHFFFAOYSA_N_000_000000
PubChem Compound ID  2712