Item 1 of 1 (back to results) ellagic acid An organic heterotetracyclic compound resulting from the formal dimerisation of gallic acid by oxidative aromatic coupling with intramolecular lactonisation of both carboxylic acid groups of the resulting biaryl. It is found in many fruits and vegetables, including raspberries, strawberries, cranberries, and pomegranates.

Current search: 05. Industrial Uses: food additive [CHEBI:64047] > ellagic acid [CHEBI:4775] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   ellagic acid [CHEBI:4775] (1) 05. Industrial Uses  05. Industrial Uses  food additive [CHEBI:64047] (41)   ellagic acid [CHEBI:4775] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   ellagic acid [CHEBI:4775] (1)  benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   ellagic acid [CHEBI:4775] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   ellagic acid [CHEBI:4775] (1)  benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   ellagic acid [CHEBI:4775] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ellagic acid [CHEBI:4775] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ellagic acid [CHEBI:4775] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   ellagic acid [CHEBI:4775] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ellagic acid [CHEBI:4775] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   ellagic acid [CHEBI:4775] (1)  benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   ellagic acid [CHEBI:4775] (1)  ester [CHEBI:35701] (3370)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   ellagic acid [CHEBI:4775] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   ellagic acid [CHEBI:4775] (1)  benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   ellagic acid [CHEBI:4775] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ellagic acid [CHEBI:4775] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   ellagic acid [CHEBI:4775] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   ellagic acid [CHEBI:4775] (1)  benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   ellagic acid [CHEBI:4775] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   ellagic acid [CHEBI:4775] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   ellagic acid [CHEBI:4775] (1)  benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   ellagic acid [CHEBI:4775] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   ellagic acid [CHEBI:4775] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   ellagic acid [CHEBI:4775] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   ellagic acid [CHEBI:4775] (1)  organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   ellagic acid [CHEBI:4775] (1)  benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   ellagic acid [CHEBI:4775] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ellagic acid [CHEBI:4775] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   ellagic acid [CHEBI:4775] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   polyphenol [CHEBI:26195] (189)   ellagic acid [CHEBI:4775] (1)  benzenediols [CHEBI:33570] (188)   catechols [CHEBI:33566] (97)   ellagic acid [CHEBI:4775] (1) 09. Chemical Capabilities  09. Chemical Capabilities  antioxidant [CHEBI:22586] (199)   ellagic acid [CHEBI:4775] (1) ChEBI Compound Accession Identifier:   [CHEBI:4775] ChEBI Compound Description:   An organic heterotetracyclic compound resulting from the formal dimerisation of gallic acid by oxidative aromatic coupling with intramolecular lactonisation of both carboxylic acid groups of the resulting biaryl. It is found in many fruits and vegetables, including raspberries, strawberries, cranberries, and pomegranates. ChEBI Compound Identification Number:   4775 ChEBI InChI Value:   InChI=1S/C14H6O8/c15-5-1-3-7-8-4(14(20)22-11(7)9(5)17)2-6(16)10(18)12(8)21-13(3)19/h1-2,15-18H ChEBI InChIKey Value:   AFSDNFLWKVMVRB-UHFFFAOYSA-N ChEBI Compound Name:   ellagic acid ChEBI SMILES Value:   Oc1cc2c3c(oc(=O)c4cc(O)c(O)c(oc2=O)c34)c1O ChEBI Substance ID:   8147026 ChEBI URL:   ChEBI:4775 ChemSpider ID:   4445149 Ontomatica Chemical Accession Key (OnChAKey):   AFSDNFLWKVMVRB_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   5281855