Item 1 of 1 (back to results) U69593 A carboxamide obtained by formal condensation between the carboxy group of phenylacetic acid and the secodary amino group of (5R,7S,8S)-N-methyl-7-(pyrrolidin-1-yl)-1-oxaspiro[4.5]decan-8-amine.

Current search: 05. Industrial Uses: anti-inflammatory agent [CHEBI:67079] > U69593 [CHEBI:73357] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   opioid agent [CHEBI:60598] (32)   kappa-opioid agent [CHEBI:60603] (6)   kappa-opioid receptor agonist [CHEBI:59282] (6)   U69593 [CHEBI:73357] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   diuretic [CHEBI:35498] (18)   U69593 [CHEBI:73357] (1)  anti-inflammatory agent [CHEBI:67079] (79)   U69593 [CHEBI:73357] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   U69593 [CHEBI:73357] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   U69593 [CHEBI:73357] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U69593 [CHEBI:73357] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   U69593 [CHEBI:73357] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   U69593 [CHEBI:73357] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U69593 [CHEBI:73357] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U69593 [CHEBI:73357] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   U69593 [CHEBI:73357] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   U69593 [CHEBI:73357] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U69593 [CHEBI:73357] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   U69593 [CHEBI:73357] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U69593 [CHEBI:73357] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U69593 [CHEBI:73357] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   U69593 [CHEBI:73357] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   spiro compound [CHEBI:33599] (78)   oxaspiro compound [CHEBI:37948] (63)   U69593 [CHEBI:73357] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   U69593 [CHEBI:73357] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   U69593 [CHEBI:73357] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U69593 [CHEBI:73357] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U69593 [CHEBI:73357] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U69593 [CHEBI:73357] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   U69593 [CHEBI:73357] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U69593 [CHEBI:73357] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U69593 [CHEBI:73357] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   U69593 [CHEBI:73357] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U69593 [CHEBI:73357] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   U69593 [CHEBI:73357] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   U69593 [CHEBI:73357] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U69593 [CHEBI:73357] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyrrolidines [CHEBI:38260] (159)   N-alkylpyrrolidine [CHEBI:46775] (24)   U69593 [CHEBI:73357] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   U69593 [CHEBI:73357] (1) ChEBI Compound Accession Identifier:   [CHEBI:73357] ChEBI Compound Description:   A carboxamide obtained by formal condensation between the carboxy group of phenylacetic acid and the secodary amino group of (5R,7S,8S)-N-methyl-7-(pyrrolidin-1-yl)-1-oxaspiro[4.5]decan-8-amine. ChEBI Compound Identification Number:   73357 ChEBI InChI Value:   InChI=1S/C22H32N2O2/c1-23(21(25)16-18-8-3-2-4-9-18)19-10-12-22(11-7-15-26-22)17-20(19)24-13-5-6-14-24/h2-4,8-9,19-20H,5-7,10-17H2,1H3/t19-,20-,22-/m0/s1 ChEBI InChIKey Value:   PGZRDDYTKFZSFR-ONTIZHBOSA-N ChEBI Compound Name:   U69593 ChEBI SMILES Value:   CN([C@H]1CC[C@@]2(CCCO2)C[C@@H]1N1CCCC1)C(=O)Cc1ccccc1 ChEBI Substance ID:   163426066 ChEBI URL:   ChEBI:73357 ChemSpider ID:   94828 Ontomatica Chemical Accession Key (OnChAKey):   PGZRDDYTKFZSFR_ONTIZHBOSA_N_000_000000 PubChem Compound ID:   105104