Item 1 of 1 (back to results) 4-methoxyphenylacetic acid A phenylacetic acid molecule carrying a 4-methoxy substituent, used as an intermediate for pharmaceuticals and other organic synthesis.

Current search: 05. Industrial Uses: agrochemical [CHEBI:33286] > fertilizer [CHEBI:33287] > 4-methoxyphenylacetic acid [CHEBI:55501] × Select any link to see items in a related category. more general categories    information about this item 05. Industrial Uses  05. Industrial Uses  pesticide [CHEBI:25944] (211)   herbicide [CHEBI:24527] (48)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  agrochemical [CHEBI:33286] (142)   fertilizer [CHEBI:33287] (6)   4-methoxyphenylacetic acid [CHEBI:55501] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   monomethoxybenzene [CHEBI:25235] (32)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   4-methoxyphenylacetic acid [CHEBI:55501] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   4-methoxyphenylacetic acid [CHEBI:55501] (1) ChEBI Compound Accession Identifier:   [CHEBI:55501] ChEBI Compound Description:   A phenylacetic acid molecule carrying a 4-methoxy substituent, used as an intermediate for pharmaceuticals and other organic synthesis. ChEBI Compound Identification Number:   55501 ChEBI InChI Value:   InChI=1S/C9H10O3/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) ChEBI InChIKey Value:   NRPFNQUDKRYCNX-UHFFFAOYSA-N ChEBI Compound Name:   4-methoxyphenylacetic acid ChEBI SMILES Value:   COc1ccc(CC(O)=O)cc1 ChEBI Substance ID:   92741057 ChEBI URL:   ChEBI:55501 ChemSpider ID:   7406 Ontomatica Chemical Accession Key (OnChAKey):   NRPFNQUDKRYCNX_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   7690