Item 1 of 1 (back to results) acifluorfen A member of the class of benzoic acids that is 2-nitrobenzoic acid in which the hydrogen at position 5 is replaced by a 2-chloro-4-(trifluoromethyl)phenoxy group. It is a herbicide used for the post-emergence control of a variety of annual broadleaf weeds.

Current search: 05. Industrial Uses: agrochemical [CHEBI:33286] > acifluorfen [CHEBI:73172] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   protoporphyrinogen oxidase inhibitor [CHEBI:73192] (1)   acifluorfen [CHEBI:73172] (1) 05. Industrial Uses  05. Industrial Uses  pesticide [CHEBI:25944] (211)   herbicide [CHEBI:24527] (48)   acifluorfen [CHEBI:73172] (1)  agrochemical [CHEBI:33286] (142)   acifluorfen [CHEBI:73172] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   acifluorfen [CHEBI:73172] (1)  benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   acifluorfen [CHEBI:73172] (1)  fluorine molecular entity [CHEBI:24062] (288)   organofluorine compound [CHEBI:37143] (275)   acifluorfen [CHEBI:73172] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   acifluorfen [CHEBI:73172] (1)  organofluorine compound [CHEBI:37143] (275)   acifluorfen [CHEBI:73172] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   nitro compound [CHEBI:35715] (192)   C-nitro compound [CHEBI:35716] (171)   acifluorfen [CHEBI:73172] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   acifluorfen [CHEBI:73172] (1)  benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   acifluorfen [CHEBI:73172] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   acifluorfen [CHEBI:73172] (1)  benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   acifluorfen [CHEBI:73172] (1)  benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   acifluorfen [CHEBI:73172] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   acifluorfen [CHEBI:73172] (1)  benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   acifluorfen [CHEBI:73172] (1)  benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   acifluorfen [CHEBI:73172] (1)  organofluorine compound [CHEBI:37143] (275)   acifluorfen [CHEBI:73172] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   acifluorfen [CHEBI:73172] (1)  carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   acifluorfen [CHEBI:73172] (1)  benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   acifluorfen [CHEBI:73172] (1)  benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   acifluorfen [CHEBI:73172] (1)  benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  aromatic ether [CHEBI:35618] (353)   acifluorfen [CHEBI:73172] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   acifluorfen [CHEBI:73172] (1)  benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  aromatic ether [CHEBI:35618] (353)   acifluorfen [CHEBI:73172] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  aromatic ether [CHEBI:35618] (353)   acifluorfen [CHEBI:73172] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  aromatic ether [CHEBI:35618] (353)   acifluorfen [CHEBI:73172] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   acifluorfen [CHEBI:73172] (1)  benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   acifluorfen [CHEBI:73172] (1)  benzoic acids [CHEBI:22723] (150)   acifluorfen [CHEBI:73172] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   acifluorfen [CHEBI:73172] (1)  organofluorine compound [CHEBI:37143] (275)   acifluorfen [CHEBI:73172] (1) ChEBI Compound Accession Identifier:   [CHEBI:73172] ChEBI Compound Description:   A member of the class of benzoic acids that is 2-nitrobenzoic acid in which the hydrogen at position 5 is replaced by a 2-chloro-4-(trifluoromethyl)phenoxy group. It is a herbicide used for the post-emergence control of a variety of annual broadleaf weeds. ChEBI Compound Identification Number:   73172 ChEBI InChI Value:   InChI=1S/C14H7ClF3NO5/c15-10-5-7(14(16,17)18)1-4-12(10)24-8-2-3-11(19(22)23)9(6-8)13(20)21/h1-6H,(H,20,21) ChEBI InChIKey Value:   NUFNQYOELLVIPL-UHFFFAOYSA-N ChEBI Compound Name:   acifluorfen ChEBI SMILES Value:   OC(=O)c1cc(Oc2ccc(cc2Cl)C(F)(F)F)ccc1[N+]([O-])=O ChEBI Substance ID:   162169336 ChEBI URL:   ChEBI:73172 ChemSpider ID:   40113 Ontomatica Chemical Accession Key (OnChAKey):   NUFNQYOELLVIPL_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   44073