New Search

Item 1 of 1 (back to results)

DAF-FM dye
null


Current search:

05. Industrial Uses: dye [CHEBI:37958] > fluorescent dye [CHEBI:51121] > fluorochrome [CHEBI:51217] > DAF-FM dye [CHEBI:52006]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 dye [CHEBI:37958] (446) 
 fluorescent dye [CHEBI:51121] (410) 
 fluorochrome [CHEBI:51217] (404) 
 DAF-FM dye [CHEBI:52006] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 DAF-FM dye [CHEBI:52006] (1)
ChEBI Compound Accession Identifier  [CHEBI:52006]
ChEBI Compound Description  null
ChEBI Compound Identification Number  52006
ChEBI InChI Value  InChI=1S/C21H14F2N2O5/c1-25-13-3-2-8(19(20(13)24)21(28)29)18-9-4-11(22)14(26)6-16(9)30-17-7-15(27)12(23)5-10(17)18/h2-7,25-26H,24H2,1H3,(H,28,29)
ChEBI InChIKey Value  BJTLSPOVXMBXRZ-UHFFFAOYSA-N
ChEBI Compound Name  DAF-FM dye
ChEBI SMILES Value  CNc1ccc(c(C(O)=O)c1N)-c1c2cc(F)c(O)cc2oc2cc(=O)c(F)cc12
ChEBI Substance ID  57304863
ChEBI URL  ChEBI:52006
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  BJTLSPOVXMBXRZ_UHFFFAOYSA_N_000_000000
PubChem Compound ID  25195393