New Search

Item 1 of 1 (back to results)

diOC18(3) dye
null


Current search:

05. Industrial Uses: dye [CHEBI:37958] > fluorescent dye [CHEBI:51121] > fluorochrome [CHEBI:51217] > diOC18(3) dye [CHEBI:52032]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 dye [CHEBI:37958] (446) 
 fluorescent dye [CHEBI:51121] (410) 
 fluorochrome [CHEBI:51217] (404) 
 diOC18(3) dye [CHEBI:52032] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 cyanine dye [CHEBI:37960] (95) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 cyanine dye [CHEBI:37960] (95) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 oxacycle [CHEBI:38104] (2002) 
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 benzoxazole [CHEBI:46700] (21) 
 1,3-benzoxazoles [CHEBI:51548] (15) 
 diOC18(3) dye [CHEBI:52032] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 heteroarene [CHEBI:33833] (1648) 
 polycyclic heteroarene [CHEBI:38180] (274) 
 benzopyrrole [CHEBI:22728] (227) 
 indoles [CHEBI:24828] (210) 
 Cy3 dye [CHEBI:37987] (6) 
 diOC18(3) dye [CHEBI:52032] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 salt [CHEBI:24866] (931) 
 organic salt [CHEBI:24868] (775) 
 organic halide salt [CHEBI:51069] (386) 
 organic perchlorate salt [CHEBI:52165] (19) 
 diOC18(3) dye [CHEBI:52032] (1)
ChEBI Compound Accession Identifier  [CHEBI:52032]
ChEBI Compound Description  null
ChEBI Compound Identification Number  52032
ChEBI InChI Value  "InChI=1S/C53H85N2O2.ClHO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-37-46-54-48-40-33-35-42-50(48)56-52(54)44-39-45-53-55(49-41-34-36-43-51(49)57-53)47-38-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;2-1(3,4)5/h33-36,39-45H,3-32,37-38,46-47H2,1-2H3;(H,2,3,4,5)/q+1;/p-1"
ChEBI InChIKey Value  GFZPJHFJZGRWMQ-UHFFFAOYSA-M
ChEBI Compound Name  diOC18(3) dye
ChEBI SMILES Value  [O-]Cl(=O)(=O)=O.[H]C(=C([H])c1oc2ccccc2[n+]1CCCCCCCCCCCCCCCCCC)C([H])=C1Oc2ccccc2N1CCCCCCCCCCCCCCCCCC
ChEBI Substance ID  57304936
ChEBI URL  ChEBI:52032
ChemSpider ID  4646068
Ontomatica Chemical Accession Key (OnChAKey)  GFZPJHFJZGRWMQ_UHFFFAOYSA_M_000_000000
PubChem Compound ID  5706734