New Search

Item 1 of 1 (back to results)

FM 1-43 dye
null

Current search:

05. Industrial Uses: dye [CHEBI:37958] > fluorescent dye [CHEBI:51121] > fluorochrome [CHEBI:51217] > FM 1-43 dye [CHEBI:52077]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 dye [CHEBI:37958] (446) 
 fluorescent dye [CHEBI:51121] (410) 
 fluorochrome [CHEBI:51217] (404) 
 FM 1-43 dye [CHEBI:52077] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 bromine molecular entity [CHEBI:22928] (199) 
 bromide salt [CHEBI:22925] (45) 
 organic bromide salt [CHEBI:48369] (33) 
 FM 1-43 dye [CHEBI:52077] (1)
 halide [CHEBI:37578] (1402) 
 halide salt [CHEBI:33958] (423) 
 bromide salt [CHEBI:22925] (45) 
 organic bromide salt [CHEBI:48369] (33) 
 FM 1-43 dye [CHEBI:52077] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 quaternary nitrogen compound [CHEBI:26469] (238) 
 quaternary ammonium salt [CHEBI:35273] (50) 
 FM 1-43 dye [CHEBI:52077] (1)
 ammonium compound [CHEBI:35276] (129) 
 organoammonium salt [CHEBI:46850] (104) 
 quaternary ammonium salt [CHEBI:35273] (50) 
 FM 1-43 dye [CHEBI:52077] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 FM 1-43 dye [CHEBI:52077] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 FM 1-43 dye [CHEBI:52077] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 FM 1-43 dye [CHEBI:52077] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 FM 1-43 dye [CHEBI:52077] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amine [CHEBI:32952] (179) 
 tertiary amine [CHEBI:32876] (84) 
 FM 1-43 dye [CHEBI:52077] (1)
 tertiary amino compound [CHEBI:50996] (199) 
 tertiary amine [CHEBI:32876] (84) 
 FM 1-43 dye [CHEBI:52077] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 salt [CHEBI:24866] (931) 
 organic salt [CHEBI:24868] (775) 
 pyridinium salt [CHEBI:38188] (12) 
 FM 1-43 dye [CHEBI:52077] (1)
 organic halide salt [CHEBI:51069] (386) 
 organic bromide salt [CHEBI:48369] (33) 
 FM 1-43 dye [CHEBI:52077] (1)
 halide salt [CHEBI:33958] (423) 
 bromide salt [CHEBI:22925] (45) 
 organic bromide salt [CHEBI:48369] (33) 
 FM 1-43 dye [CHEBI:52077] (1)
 halide [CHEBI:37578] (1402) 
 halide salt [CHEBI:33958] (423) 
 bromide salt [CHEBI:22925] (45) 
 organic bromide salt [CHEBI:48369] (33) 
 FM 1-43 dye [CHEBI:52077] (1)
ChEBI Compound Accession Identifier:   [CHEBI:52077]
ChEBI Compound Description:   null
ChEBI Compound Identification Number:   52077
ChEBI InChI Value:   "InChI=1S/C30H49N3.2BrH/c1-6-11-23-32(24-12-7-2)30-18-16-28(17-19-30)14-15-29-20-25-31(26-21-29)22-13-27-33(8-3,9-4)10-5;;/h14-21,25-26H,6-13,22-24,27H2,1-5H3;2*1H/q+2;;/p-2"
ChEBI InChIKey Value:   VZUVCAGXYLMFEC-UHFFFAOYSA-L
ChEBI Compound Name:   FM 1-43 dye
ChEBI SMILES Value:   [Br-].[Br-].[H]C(=Cc1cc[n+](CCC[N+](CC)(CC)CC)cc1)c1ccc(cc1)N(CCCC)CCCC
ChEBI Substance ID:   57304854
ChEBI URL:   ChEBI:52077
ChemSpider ID:   2015396
Ontomatica Chemical Accession Key (OnChAKey):   VZUVCAGXYLMFEC_UHFFFAOYSA_L_000_000000
PubChem Compound ID:   6508724