New Search

Item 1 of 1 (back to results)

5-(N-hexadecanoyl)aminofluorescin
A fluorescin compound having a hexadecanoylamino substituent at the 5-position.


Current search:

05. Industrial Uses: dye [CHEBI:37958] > fluorescent dye [CHEBI:51121] > fluorochrome [CHEBI:51217] > 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 dye [CHEBI:37958] (446) 
 fluorescent dye [CHEBI:51121] (410) 
 fluorochrome [CHEBI:51217] (404) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthene dye [CHEBI:37929] (65) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 benzoic acids [CHEBI:22723] (150) 
 amidobenzoic acid [CHEBI:48470] (7) 
 5-(N-hexadecanoyl)aminofluorescin [CHEBI:52745] (1)
ChEBI Compound Accession Identifier  [CHEBI:52745]
ChEBI Compound Description  A fluorescin compound having a hexadecanoylamino substituent at the 5-position.
ChEBI Compound Identification Number  52745
ChEBI InChI Value  InChI=1S/C36H43NO6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-34(40)37-25-16-19-28(31(22-25)36(41)42)35-29-20-17-26(38)23-32(29)43-33-24-27(39)18-21-30(33)35/h16-24,38H,2-15H2,1H3,(H,37,40)(H,41,42)
ChEBI InChIKey Value  NIOAQWNBYGPMHJ-UHFFFAOYSA-N
ChEBI Compound Name  5-(N-hexadecanoyl)aminofluorescin
ChEBI SMILES Value  CCCCCCCCCCCCCCCC(=O)Nc1ccc(c(c1)C(O)=O)-c1c2ccc(O)cc2oc2cc(=O)ccc12
ChEBI Substance ID  85096700
ChEBI URL  ChEBI:52745
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  NIOAQWNBYGPMHJ_UHFFFAOYSA_N_000_000000
PubChem Compound ID  44140606