New Search

Item 1 of 1 (back to results)

cryptocyanin
null


Current search:

05. Industrial Uses: dye [CHEBI:37958] > fluorescent dye [CHEBI:51121] > fluorochrome [CHEBI:51217] > cryptocyanin [CHEBI:51502]
×

Select any link to see items in a related category.

more general categories    information about this item
05. Industrial Uses 
05. Industrial Uses
 dye [CHEBI:37958] (446) 
 fluorescent dye [CHEBI:51121] (410) 
 fluorochrome [CHEBI:51217] (404) 
 cryptocyanin [CHEBI:51502] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 iodine molecular entity [CHEBI:24860] (127) 
 iodide salt [CHEBI:24858] (45) 
 organic iodide salt [CHEBI:50356] (40) 
 cryptocyanin [CHEBI:51502] (1)
 halide [CHEBI:37578] (1402) 
 halide salt [CHEBI:33958] (423) 
 iodide salt [CHEBI:24858] (45) 
 organic iodide salt [CHEBI:50356] (40) 
 cryptocyanin [CHEBI:51502] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 aromatic compound [CHEBI:33655] (3799) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 cryptocyanin [CHEBI:51502] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 salt [CHEBI:24866] (931) 
 organic salt [CHEBI:24868] (775) 
 organic halide salt [CHEBI:51069] (386) 
 organic iodide salt [CHEBI:50356] (40) 
 cryptocyanin [CHEBI:51502] (1)
 halide salt [CHEBI:33958] (423) 
 iodide salt [CHEBI:24858] (45) 
 organic iodide salt [CHEBI:50356] (40) 
 cryptocyanin [CHEBI:51502] (1)
 halide [CHEBI:37578] (1402) 
 halide salt [CHEBI:33958] (423) 
 iodide salt [CHEBI:24858] (45) 
 organic iodide salt [CHEBI:50356] (40) 
 cryptocyanin [CHEBI:51502] (1)
ChEBI Compound Accession Identifier  [CHEBI:51502]
ChEBI Compound Description  null
ChEBI Compound Identification Number  51502
ChEBI InChI Value  "InChI=1S/C25H25N2.HI/c1-3-26-18-16-20(22-12-5-7-14-24(22)26)10-9-11-21-17-19-27(4-2)25-15-8-6-13-23(21)25;/h5-19H,3-4H2,1-2H3;1H/q+1;/p-1"
ChEBI InChIKey Value  CEJANLKHJMMNQB-UHFFFAOYSA-M
ChEBI Compound Name  cryptocyanin
ChEBI SMILES Value  [I-].[H]C(=C([H])c1cc[n+](CC)c2ccccc12)C([H])=C1C=CN(CC)c2ccccc12
ChEBI Substance ID  56464198
ChEBI URL  ChEBI:51502
ChemSpider ID  85101
Ontomatica Chemical Accession Key (OnChAKey)  CEJANLKHJMMNQB_UHFFFAOYSA_M_000_000000
PubChem Compound ID  5351156